Drug Information| Drug ID:   | NPD5937 |
| Drug Name:   | Ivacaftor |
| Molecular Formula:   | C24H28N2O3 |
| Canonical SMILES:   | OC(=Nc1cc(O)c(cc1C(C)(C)C)C(C)(C)C)c1c[nH]c2c(c1=O)cccc2 |
| Standard InCHI:   | "InChI=1S/C24H28N2O3/c1-23(2,3)16-11-17(24(4,5)6)20(27)12-19(16)26-22(29)15-13-25-18-10-8-7-9-14(18)21(15)28/h7-13,27H,1-6H3,(H,25,28)(H,26,29)" |
| Standard InCHIKey:   | PURKAOJPTOLRMP-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5937Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001684 |
| DrugBank   | DB08820 |
| ChEMBL   | CHEMBL2010601 |
| IUPHAR/BPS   | 4342 |
| PharmaGKB   | PA165950341 |
| KEGG Drug   | D09916 |
| PubChem CID   | 16220172 |
| ChEBI   | 66901 |
| CAS Number   | 873054-44-5 |
| Molecular Weight   | 392.21 |
| ALogP   | 1.6375 |
| MLogP   | 3.55 |
| XLogP   | 7.776 |
| HDA   | 4 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 81.92 |
| RO5 Violation   | 1 |