Drug Information| Drug ID:   | NPD5797 |
| Drug Name:   | Neomycin Sulfate |
| Molecular Formula:   | C23H46N6O13.H2O4S |
| Canonical SMILES:   | OS(=O)(=O)O.OC[C@H]1O[C@H]([C@@H]([C@@H]1O[C@H]1O[C@@H](CN)[C@H]([C@@H]([C@H]1N)O)O)O)O[C@@H]1[C@@H](O)[C@H](N)C[C@@H]([C@H]1O[C@H]1O[C@H](CN)[C@H]([C@@H]([C@H]1N)O)O)N |
| Standard InCHI:   | "InChI=1S/C23H46N6O13.H2O4S/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22;1-5(2,3)4/h5-23,30-36H,1-4,24-29H2;(H2,1,2,3,4)/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1" |
| Standard InCHIKey:   | OIXVKQDWLFHVGR-WQDIDPJDSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5797Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9107 | NPC611963 |
| High Similarity | 0.9107 | NPC564340 |
| High Similarity | 0.9107 | NPC581720 |
| High Similarity | 0.85 | NPC611441 |
| High Similarity | 0.85 | NPC568142 |
| High Similarity | 0.85 | NPC573759 |
| High Similarity | 0.85 | NPC592740 |
| Intermediate Similarity | 0.7727 | NPC542895 |
| Intermediate Similarity | 0.7727 | NPC559965 |
| Intermediate Similarity | 0.75 | NPC506976 |
| Intermediate Similarity | 0.75 | NPC563546 |
| Intermediate Similarity | 0.7167 | NPC611914 |
| Intermediate Similarity | 0.7167 | NPC589299 |
| Remote Similarity | 0.6825 | NPC497825 |
| Remote Similarity | 0.6825 | NPC519469 |
| Remote Similarity | 0.6825 | NPC539880 |
| Remote Similarity | 0.6825 | NPC544422 |
| Remote Similarity | 0.6825 | NPC557727 |
| Remote Similarity | 0.6719 | NPC523807 |
| Remote Similarity | 0.6429 | NPC527051 |
| Remote Similarity | 0.6418 | NPC506484 |
| Remote Similarity | 0.6418 | NPC513869 |
| Remote Similarity | 0.6418 | NPC551092 |
| Remote Similarity | 0.6418 | NPC575207 |
| Remote Similarity | 0.5873 | NPC606532 |
| Remote Similarity | 0.5714 | NPC602333 |
| Remote Similarity | 0.5352 | NPC607776 |
| Remote Similarity | 0.5224 | NPC548723 |
| Remote Similarity | 0.5224 | NPC579324 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 614.31 |
| ALogP   | -9.3091 |
| MLogP   | 1.9 |
| XLogP   | -6.914 |
| HDA   | 19 |
| HBD   | 13 |
| Rotatable Bonds   | 22 |
| TPSA   | 353.11 |
| RO5 Violation   | 2 |