Drug Information| Drug ID:   | NPD5796 |
| Drug Name:   | |
| Molecular Formula:   | C23H45N5O14 |
| Canonical SMILES:   | OC[C@H]1OC([C@@H]([C@@H]1O[C@H]1O[C@@H](CN)[C@H]([C@@H]([C@H]1N)O)O)O)O[C@@H]1[C@@H](O)[C@H](N)C[C@@H](C1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1N)O)O)N |
| Standard InCHI:   | "InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18?,19-,20-,21-,22-,23?/m1/s1" |
| Standard InCHIKey:   | UOZODPSAJZTQNH-QGSSWKKLSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5796Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC611441 |
| High Similarity | 1.0 | NPC568142 |
| High Similarity | 1.0 | NPC573759 |
| High Similarity | 1.0 | NPC592740 |
| High Similarity | 0.9273 | NPC611963 |
| High Similarity | 0.9273 | NPC564340 |
| High Similarity | 0.9273 | NPC581720 |
| High Similarity | 0.8909 | NPC506976 |
| High Similarity | 0.8909 | NPC563546 |
| Intermediate Similarity | 0.8413 | NPC542895 |
| Intermediate Similarity | 0.8413 | NPC559965 |
| Intermediate Similarity | 0.7586 | NPC611914 |
| Intermediate Similarity | 0.7586 | NPC589299 |
| Intermediate Similarity | 0.7581 | NPC506484 |
| Intermediate Similarity | 0.7581 | NPC513869 |
| Intermediate Similarity | 0.7581 | NPC551092 |
| Intermediate Similarity | 0.7581 | NPC575207 |
| Intermediate Similarity | 0.7377 | NPC523807 |
| Intermediate Similarity | 0.7069 | NPC606532 |
| Remote Similarity | 0.6935 | NPC497825 |
| Remote Similarity | 0.6935 | NPC519469 |
| Remote Similarity | 0.6935 | NPC539880 |
| Remote Similarity | 0.6935 | NPC544422 |
| Remote Similarity | 0.6935 | NPC557727 |
| Remote Similarity | 0.6522 | NPC527051 |
| Remote Similarity | 0.6438 | NPC602333 |
| Remote Similarity | 0.5538 | NPC548723 |
| Remote Similarity | 0.5538 | NPC579324 |
| Molecular Weight   | 615.3 |
| ALogP   | -9.0195 |
| MLogP   | 1.9 |
| XLogP   | -6.847 |
| HDA   | 19 |
| HBD   | 13 |
| Rotatable Bonds   | 22 |
| TPSA   | 347.32 |
| RO5 Violation   | 2 |