Drug Information| Drug ID:   | NPD5765 |
| Drug Name:   | latanoprost (free acid form) |
| Molecular Formula:   | C23H34O5 |
| Canonical SMILES:   | O[C@@H](CCc1ccccc1)CC[C@H]1[C@H](O)C[C@@H]([C@@H]1C/C=CCCCC(=O)O)O |
| Standard InCHI:   | "InChI=1S/C23H34O5/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28/h1,3-6,8-9,18-22,24-26H,2,7,10-16H2,(H,27,28)/b6-1-/t18-,19+,20+,21-,22+/m0/s1" |
| Standard InCHIKey:   | HNPFPERDNWXAGS-NFVOFSAMSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5765Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6167 | NPC324411 |
| Remote Similarity | 0.6087 | NPC318342 |
| Remote Similarity | 0.5714 | NPC321670 |
| Remote Similarity | 0.5714 | NPC609245 |
| Remote Similarity | 0.5077 | NPC328775 |
| Molecular Weight   | 390.24 |
| ALogP   | -2.3975 |
| MLogP   | 3.44 |
| XLogP   | 5.226 |
| HDA   | 5 |
| HBD   | 4 |
| Rotatable Bonds   | 16 |
| TPSA   | 97.99 |
| RO5 Violation   | 2 |