Drug Information| Drug ID: | NPD5741 |
| Drug Name: | Prajmalium Bitartrate |
| Molecular Formula: | C23H33N2O2.C4H6O6 |
| Canonical SMILES: | [O-]C(=O)C(C(C(=O)O)O)O.CCC[N+]12[C@H]3C[C@@]45[C@H]([C@@H]2C[C@H]([C@H]3[C@H]4O)[C@@H]([C@H]1O)CC)N(C)c1c5cccc1 |
| Standard InCHI: | InChI=1S/C23H33N2O2.C4H6O6/c1-4-10-25-17-11-14(13(5-2)22(25)27)19-18(25)12-23(21(19)26)15-8-6-7-9-16(15)24(3)20(17)23;5-1(3(7)8)2(6)4(9)10/h6-9,13-14,17-22,26-27H,4-5,10-12H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/p-1/t13-,14-,17-,18-,19+,20-,21+,22+,23+,25?;/m0./s1 |
| Standard InCHIKey: | VZAUGYDMVQSQAO-BAYLNNJJSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD5741Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7