Drug Information| Drug ID:   | NPD571 |
| Drug Name:   | Talbutal |
| Molecular Formula:   | C11H16N2O3 |
| Canonical SMILES:   | CCC(C1(CC=C)C(=NC(=O)N=C1O)O)C |
| Standard InCHI:   | "InChI=1S/C11H16N2O3/c1-4-6-11(7(3)5-2)8(14)12-10(16)13-9(11)15/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16)" |
| Standard InCHIKey:   | BJVVMKUXKQHWJK-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD571Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DAP000670 |
| DrugBank   | DB00306 |
| ChEMBL   | CHEMBL1200802 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164779051 |
| KEGG Drug   | D06887 |
| PubChem CID   | 8275 |
| ChEBI   | 134923 |
| CAS Number   | 115-44-6 |
| Molecular Weight   | 224.12 |
| ALogP   | -0.5051 |
| MLogP   | 2.12 |
| XLogP   | 2.703 |
| HDA   | 5 |
| HBD   | 2 |
| Rotatable Bonds   | 8 |
| TPSA   | 82.25 |
| RO5 Violation   | 0 |