Drug Information| Drug ID:   | NPD5613 |
| Drug Name:   | Piperacillin Sodium |
| Molecular Formula:   | C23H27N5O7S.Na |
| Canonical SMILES:   | CCN1CCN(C(=O)C1=O)C(=N[C@@H](C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)[O-])c1ccccc1)O.[Na+] |
| Standard InCHI:   | "InChI=1S/C23H27N5O7S.Na/c1-4-26-10-11-27(19(32)18(26)31)22(35)25-13(12-8-6-5-7-9-12)16(29)24-14-17(30)28-15(21(33)34)23(2,3)36-20(14)28;/h5-9,13-15,20H,4,10-11H2,1-3H3,(H,24,29)(H,25,35)(H,33,34);/q;+1/p-1/t13-,14-,15+,20-;/m1./s1" |
| Standard InCHIKey:   | WCMIIGXFCMNQDS-IDYPWDAWSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5613Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7333 | NPC487965 |
| Remote Similarity | 0.5541 | NPC485035 |
| Remote Similarity | 0.5541 | NPC469134 |
| Remote Similarity | 0.5333 | NPC330588 |
| Remote Similarity | 0.5263 | NPC90478 |
| Remote Similarity | 0.5128 | NPC468984 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 516.16 |
| ALogP   | -1.2453 |
| MLogP   | 2.56 |
| XLogP   | 1.695 |
| HDA   | 12 |
| HBD   | 2 |
| Rotatable Bonds   | 13 |
| TPSA   | 191.54 |
| RO5 Violation   | 1 |