Drug Information| Drug ID:   | NPD5563 |
| Drug Name:   | |
| Molecular Formula:   | C23H25NO6S |
| Canonical SMILES:   | CC(=O)SC[C@H](C(=N[C@H](C(=O)OCc1ccccc1)C)O)Cc1ccc2c(c1)OCO2 |
| Standard InCHI:   | "InChI=1S/C23H25NO6S/c1-15(23(27)28-12-17-6-4-3-5-7-17)24-22(26)19(13-31-16(2)25)10-18-8-9-20-21(11-18)30-14-29-20/h3-9,11,15,19H,10,12-14H2,1-2H3,(H,24,26)/t15-,19+/m0/s1" |
| Standard InCHIKey:   | KKBIUAUSZKGNOA-HNAYVOBHSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5563Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 443.14 |
| ALogP   | 0.0955 |
| MLogP   | 3.11 |
| XLogP   | 4.825 |
| HDA   | 5 |
| HBD   | 1 |
| Rotatable Bonds   | 14 |
| TPSA   | 119.72 |
| RO5 Violation   | 1 |