Drug Information| Drug ID: | NPD556 |
| Drug Name: | Methocarbamol |
| Molecular Formula: | C11H15NO5 |
| Canonical SMILES: | COc1ccccc1OCC(COC(=N)O)O |
| Standard InCHI: | InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
| Standard InCHIKey: | GNXFOGHNGIVQEH-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD556Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| TTD | DIB014373 |
| DrugBank | DB00423 |
| ChEMBL | CHEMBL1201117 |
| IUPHAR/BPS | 6829 |
| PharmaGKB | PA164749506 |
| KEGG Drug | D00402 |
| PubChem CID | 4107 |
| ChEBI | 77498 |
| CAS Number | 532-03-6 |
| Molecular Weight | 241.10 |
| ALogP | -0.2242 |
| MLogP | 2.01 |
| XLogP | 1.523 |
| HDA | 4 |
| HBD | 3 |
| Rotatable Bonds | 10 |
| TPSA | 92 |
| RO5 Violation | 0 |