NPASS drugs

Drug Information

Drug ID:	NPD549
Drug Name:	Nelarabine
Molecular Formula:	C11H15N5O5
Canonical SMILES:	OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1cnc2c1[nH]c(=N)nc2OC
Standard InCHI:	"InChI=1S/C11H15N5O5/c1-20-9-5-8(14-11(12)15-9)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7+,10-/m1/s1"
Standard InCHIKey:	IXOXBSCIXZEQEQ-UHTZMRCNSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD549

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	150878
0.1-0.2	59957
0.2-0.3	719
0.3-0.4	152
0.4-0.5	29
0.5-0.6	3
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6393	NPC61198
Remote Similarity	0.6393	NPC105915
Remote Similarity	0.5484	NPC567521
Remote Similarity	0.5385	NPC487897
Remote Similarity	0.5075	NPC594325

Drug Structure

NPD549 OpenBabel08201723202D 26 28 0 0 1 0 0 0 0 0999 V2000 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9761 2.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0685 2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0625 1.6303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8546 0.6522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8601 0.5477 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4533 1.4612 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0739 2.4781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4752 1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.7851 1.4493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5237 -0.0909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3601 -0.3184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1965 2.1303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6986 1.8560 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5019 0.1170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8601 -1.1844 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 17 1 0 0 0 0 3 13 2 0 0 0 0 3 16 1 0 0 0 0 4 2 1 6 0 0 0 4 6 1 0 0 0 0 4 21 1 0 0 0 0 5 8 2 0 0 0 0 5 9 1 0 0 0 0 5 13 1 0 0 0 0 6 7 1 0 0 0 0 6 18 1 1 0 0 0 7 10 1 0 0 0 0 7 19 1 6 0 0 0 8 14 1 0 0 0 0 8 16 1 0 0 0 0 9 15 2 0 0 0 0 9 20 1 0 0 0 0 10 16 1 6 0 0 0 10 21 1 0 0 0 0 11 12 2 0 0 0 0 11 14 1 0 0 0 0 11 15 1 0 0 0 0 12 22 1 0 0 0 0 14 23 1 0 0 0 0 17 24 1 0 0 0 0 18 25 1 0 0 0 0 19 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000985
DrugBank	DB01280
ChEMBL	CHEMBL1201112
IUPHAR/BPS	7090
PharmaGKB	PA164752425
KEGG Drug	D05134
PubChem CID	3011155
ChEBI	63612
CAS Number	121032-29-9

Drug Properties

Molecular Weight	297.11
ALogP	-1.9642
MLogP	1.57
XLogP	-1.322
HDA	10
HBD	5
Rotatable Bonds	7
TPSA	145.21
RO5 Violation	0