Drug Information| Drug ID: | NPD543 |
| Drug Name: | |
| Molecular Formula: | C11H15N3S |
| Canonical SMILES: | CN1CCC=C2C1CCc1c2[nH]c(=N)s1 |
| Standard InCHI: | InChI=1S/C11H15N3S/c1-14-6-2-3-7-8(14)4-5-9-10(7)13-11(12)15-9/h3,8H,2,4-6H2,1H3,(H2,12,13) |
| Standard InCHIKey: | XFJSSDHKIXXJLM-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD543Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5773 | NPC476141 |
| Remote Similarity | 0.5714 | NPC325268 |
| Remote Similarity | 0.5682 | NPC472735 |