NPASS drugs

Drug Information

Drug ID:	NPD5327
Drug Name:	Promestriene
Molecular Formula:	C22H32O2
Canonical SMILES:	CCCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2OC)C
Standard InCHI:	"InChI=1S/C22H32O2/c1-4-13-24-16-6-8-17-15(14-16)5-7-19-18(17)11-12-22(2)20(19)9-10-21(22)23-3/h6,8,14,18-21H,4-5,7,9-13H2,1-3H3/t18-,19-,20+,21+,22+/m1/s1"
Standard InCHIKey:	IUWKNLFTJBHTSD-AANPDWTMSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5327

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	50758
0.1-0.2	156137
0.2-0.3	4766
0.3-0.4	59
0.4-0.5	16
0.5-0.6	4
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5758	NPC498325
Remote Similarity	0.5672	NPC33900
Remote Similarity	0.5672	NPC575904
Remote Similarity	0.5362	NPC220771

Drug Structure

NPD5327 OpenBabel08211706322D 24 27 0 0 1 0 0 0 0 0999 V2000 6.9987 -4.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 1.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7937 1.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5123 -3.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6856 -2.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2112 -1.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8431 -2.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3693 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6833 -0.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6836 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6848 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8423 0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5401 -3.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3698 -2.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 -2.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2115 -2.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5276 -1.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6851 -0.9716 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8428 -1.4582 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0003 -0.9721 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8425 0.4861 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8431 1.4578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0536 -2.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 3 23 1 0 0 0 0 4 13 1 0 0 0 0 5 7 1 0 0 0 0 5 15 1 0 0 0 0 6 8 1 0 0 0 0 6 16 2 0 0 0 0 8 17 2 0 0 0 0 9 10 1 0 0 0 0 9 20 1 0 0 0 0 10 21 1 0 0 0 0 11 12 1 0 0 0 0 12 22 1 0 0 0 0 13 24 1 0 0 0 0 14 15 2 0 0 0 0 14 16 1 0 0 0 0 15 17 1 0 0 0 0 16 24 1 0 0 0 0 17 18 1 0 0 0 0 18 11 1 6 0 0 0 18 19 1 0 0 0 0 19 7 1 1 0 0 0 19 20 1 0 0 0 0 20 22 1 6 0 0 0 21 22 1 6 0 0 0 21 23 1 0 0 0 0 22 2 1 6 0 0 0 M END $$$$

External Identifiers

TTD	DIB013211
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	328.24
ALogP	0.0197
MLogP	3.66
XLogP	6.465
HDA	1
HBD	0
Rotatable Bonds	7
TPSA	18.46
RO5 Violation	1