NPASS drugs

Drug Information

Drug ID:	NPD5258
Drug Name:	Sufentanil Citrate
Molecular Formula:	C22H30N2O2S.C6H8O7
Canonical SMILES:	OC(=O)C(CC(=O)O)(CC(=O)O)O.COCC1(CCN(CC1)CCc1cccs1)N(c1ccccc1)C(=O)CC
Standard InCHI:	InChI=1S/C22H30N2O2S.C6H8O7/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-10,17H,3,11-16,18H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
Standard InCHIKey:	OJCZPLDERGDQRJ-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5258

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	112
0.1-0.2	2342
0.2-0.3	13243
0.3-0.4	10769
0.4-0.5	3562
0.5-0.6	837
0.6-0.7	25
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6692	NPC120203
Remote Similarity	0.6577	NPC473417
Remote Similarity	0.6541	NPC291610
Remote Similarity	0.6474	NPC470301
Remote Similarity	0.6466	NPC11466
Remote Similarity	0.6414	NPC316582
Remote Similarity	0.6398	NPC321617
Remote Similarity	0.6391	NPC75496
Remote Similarity	0.6369	NPC328270
Remote Similarity	0.6324	NPC328877
Remote Similarity	0.6276	NPC228515
Remote Similarity	0.6266	NPC22082
Remote Similarity	0.6266	NPC186284
Remote Similarity	0.625	NPC187231
Remote Similarity	0.6222	NPC326792
Remote Similarity	0.6207	NPC31651
Remote Similarity	0.6203	NPC130251
Remote Similarity	0.619	NPC143325
Remote Similarity	0.6187	NPC20322
Remote Similarity	0.6139	NPC469560
Remote Similarity	0.6129	NPC130655
Remote Similarity	0.6115	NPC471123
Remote Similarity	0.6071	NPC29285
Remote Similarity	0.6036	NPC113946
Remote Similarity	0.6024	NPC243756
Remote Similarity	0.5973	NPC302169
Remote Similarity	0.5964	NPC473329
Remote Similarity	0.5963	NPC301760
Remote Similarity	0.5951	NPC320863
Remote Similarity	0.5948	NPC250476
Remote Similarity	0.593	NPC472120
Remote Similarity	0.593	NPC472101
Remote Similarity	0.592	NPC475920
Remote Similarity	0.5915	NPC477556
Remote Similarity	0.5906	NPC226143
Remote Similarity	0.589	NPC469537
Remote Similarity	0.5886	NPC316104
Remote Similarity	0.5886	NPC162417
Remote Similarity	0.5876	NPC285622
Remote Similarity	0.5872	NPC472102
Remote Similarity	0.5872	NPC225319
Remote Similarity	0.5872	NPC309531
Remote Similarity	0.5862	NPC472106
Remote Similarity	0.585	NPC218710
Remote Similarity	0.5844	NPC273714
Remote Similarity	0.5838	NPC176983
Remote Similarity	0.5838	NPC472117
Remote Similarity	0.5833	NPC66936
Remote Similarity	0.5833	NPC154602
Remote Similarity	0.5829	NPC214960
Remote Similarity	0.5829	NPC279527
Remote Similarity	0.5828	NPC314192
Remote Similarity	0.5824	NPC161143
Remote Similarity	0.5822	NPC57051
Remote Similarity	0.5821	NPC473661
Remote Similarity	0.5819	NPC471648
Remote Similarity	0.5818	NPC470824
Remote Similarity	0.5814	NPC471122
Remote Similarity	0.5802	NPC204156
Remote Similarity	0.5802	NPC315051
Remote Similarity	0.58	NPC177684
Remote Similarity	0.58	NPC291962
Remote Similarity	0.5799	NPC122106
Remote Similarity	0.5796	NPC231382
Remote Similarity	0.5789	NPC315257
Remote Similarity	0.5778	NPC28848
Remote Similarity	0.5778	NPC14325
Remote Similarity	0.5778	NPC474974
Remote Similarity	0.5764	NPC190955
Remote Similarity	0.5763	NPC91895
Remote Similarity	0.5762	NPC258531
Remote Similarity	0.5762	NPC112373
Remote Similarity	0.5762	NPC161956
Remote Similarity	0.5758	NPC470822
Remote Similarity	0.5756	NPC104345
Remote Similarity	0.5749	NPC212799
Remote Similarity	0.5747	NPC286871
Remote Similarity	0.5744	NPC314930
Remote Similarity	0.5744	NPC214827
Remote Similarity	0.5724	NPC257490
Remote Similarity	0.5724	NPC475915
Remote Similarity	0.5722	NPC329961
Remote Similarity	0.5722	NPC122427
Remote Similarity	0.5714	NPC109787
Remote Similarity	0.5714	NPC267508
Remote Similarity	0.5707	NPC2933
Remote Similarity	0.5707	NPC302235
Remote Similarity	0.5706	NPC117032
Remote Similarity	0.5705	NPC476950
Remote Similarity	0.5698	NPC469536
Remote Similarity	0.5698	NPC177261
Remote Similarity	0.5698	NPC473743
Remote Similarity	0.569	NPC143457
Remote Similarity	0.569	NPC201424
Remote Similarity	0.5689	NPC470440
Remote Similarity	0.5687	NPC313352
Remote Similarity	0.5684	NPC239660
Remote Similarity	0.5684	NPC106235
Remote Similarity	0.5684	NPC294693
Remote Similarity	0.5682	NPC471124
Remote Similarity	0.5679	NPC287358
Remote Similarity	0.5679	NPC122553
Remote Similarity	0.5676	NPC259626
Remote Similarity	0.5673	NPC478076
Remote Similarity	0.5671	NPC468984
Remote Similarity	0.5671	NPC104483
Remote Similarity	0.5665	NPC61013
Remote Similarity	0.5665	NPC79386
Remote Similarity	0.5661	NPC165538
Remote Similarity	0.5659	NPC475094
Remote Similarity	0.5657	NPC475024
Remote Similarity	0.5657	NPC282339
Remote Similarity	0.5657	NPC99632
Remote Similarity	0.5652	NPC300299
Remote Similarity	0.5652	NPC256288
Remote Similarity	0.565	NPC472115
Remote Similarity	0.565	NPC472114
Remote Similarity	0.5649	NPC283130
Remote Similarity	0.5649	NPC328683
Remote Similarity	0.5644	NPC65408
Remote Similarity	0.5641	NPC182507
Remote Similarity	0.5636	NPC238499
Remote Similarity	0.5635	NPC129624
Remote Similarity	0.5633	NPC300315
Remote Similarity	0.5633	NPC287895
Remote Similarity	0.5632	NPC193410
Remote Similarity	0.5632	NPC276085
Remote Similarity	0.5617	NPC325599
Remote Similarity	0.5614	NPC285381
Remote Similarity	0.5611	NPC251212
Remote Similarity	0.5611	NPC214626
Remote Similarity	0.5611	NPC96901
Remote Similarity	0.5611	NPC139085
Remote Similarity	0.5608	NPC187036
Remote Similarity	0.5608	NPC296163
Remote Similarity	0.5605	NPC151779
Remote Similarity	0.5605	NPC478079
Remote Similarity	0.5602	NPC478040
Remote Similarity	0.5602	NPC308197
Remote Similarity	0.56	NPC248117
Remote Similarity	0.56	NPC474058
Remote Similarity	0.56	NPC68650

Drug Structure

NPD5258 OpenBabel08211706322D 44 45 0 0 0 0 0 0 0 0999 V2000 4.7731 -5.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7731 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2731 -4.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2731 -3.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7731 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7731 -3.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8090 -3.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7731 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7731 -3.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1180 -2.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 -1.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7731 -1.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9071 -2.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1750 -0.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9071 -0.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0411 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 -3.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7731 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2731 -3.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3090 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7731 -3.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7731 -2.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0411 -1.2321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.2731 -3.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7731 -3.9641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2731 -1.3660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.8198 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 12.7372 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3712 -4.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7372 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3712 -4.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0052 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8712 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8712 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6032 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8712 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.8712 -5.2321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0052 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1391 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3712 -2.6340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6032 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8712 -5.2321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2731 -4.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3712 -2.6340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 26 1 0 0 0 0 3 21 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 8 1 0 0 0 0 6 9 2 0 0 0 0 7 10 1 0 0 0 0 7 17 2 0 0 0 0 8 19 2 0 0 0 0 9 19 1 0 0 0 0 10 20 2 0 0 0 0 11 14 1 0 0 0 0 11 20 1 0 0 0 0 12 15 1 0 0 0 0 12 22 1 0 0 0 0 13 16 1 0 0 0 0 13 22 1 0 0 0 0 14 23 1 0 0 0 0 15 23 1 0 0 0 0 16 23 1 0 0 0 0 17 27 1 0 0 0 0 18 22 1 0 0 0 0 18 26 1 0 0 0 0 19 24 1 0 0 0 0 20 27 1 0 0 0 0 21 24 1 0 0 0 0 21 25 2 0 0 0 0 22 24 1 0 0 0 0 28 30 1 0 0 0 0 28 33 1 0 0 0 0 29 31 1 0 0 0 0 29 33 1 0 0 0 0 30 34 2 0 0 0 0 30 35 1 0 0 0 0 31 36 2 0 0 0 0 31 37 1 0 0 0 0 32 33 1 0 0 0 0 32 38 2 0 0 0 0 32 39 1 0 0 0 0 33 40 1 0 0 0 0 35 41 1 0 0 0 0 37 42 1 0 0 0 0 39 43 1 0 0 0 0 40 44 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	386.20
ALogP	-1.0992
MLogP	3.33
XLogP	4.804
HDA	4
HBD	0
Rotatable Bonds	11
TPSA	61.02
RO5 Violation	0