Drug Information| Drug ID:   | NPD521 |
| Drug Name:   | |
| Molecular Formula:   | C11H13NO8 |
| Canonical SMILES:   | O[C@H]1O[C@H](Oc2ccc(cc2)N(=O)=O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI:   | "InChI=1S/C11H13NO8/c13-7-8(14)10(16)20-11(9(7)15)19-6-3-1-5(2-4-6)12(17)18/h1-4,7-11,13-16H/t7-,8-,9+,10-,11-/m0/s1" |
| Standard InCHIKey:   | VZBHOPHDDNTGCY-HHKYUTTNSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD521Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6 | NPC604439 |
| Molecular Weight   | 287.06 |
| ALogP   | -1.3761 |
| MLogP   | 1.68 |
| XLogP   | 0.749 |
| HDA   | 5 |
| HBD   | 4 |
| Rotatable Bonds   | 8 |
| TPSA   | 142.52 |
| RO5 Violation   | 0 |