Drug Information| Drug ID:   | NPD518 |
| Drug Name:   | |
| Molecular Formula:   | C11H13NO3 |
| Canonical SMILES:   | COC(=O)c1ccccc1C(=O)N(C)C |
| Standard InCHI:   | "InChI=1S/C11H13NO3/c1-12(2)10(13)8-6-4-5-7-9(8)11(14)15-3/h4-7H,1-3H3" |
| Standard InCHIKey:   | HJPZFXYWMRWNHV-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD518Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNCL002647 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 213517 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 207.09 |
| ALogP   | -0.419 |
| MLogP   | 2.23 |
| XLogP   | 1.945 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 7 |
| TPSA   | 46.61 |
| RO5 Violation   | 0 |