Drug Information| Drug ID:   | NPD5160 |
| Drug Name:   | SR-58894A |
| Molecular Formula:   | C22H27NO2 |
| Canonical SMILES:   | C=CCc1ccccc1OC[C@H](CN[C@H]1CCCc2c1cccc2)O |
| Standard InCHI:   | "InChI=1S/C22H27NO2/c1-2-8-18-10-4-6-14-22(18)25-16-19(24)15-23-21-13-7-11-17-9-3-5-12-20(17)21/h2-6,9-10,12,14,19,21,23-24H,1,7-8,11,13,15-16H2/t19-,21-/m0/s1" |
| Standard InCHIKey:   | NHTDRQUZRYNHPD-FPOVZHCZSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5160Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5968 | NPC136112 |
| Remote Similarity | 0.5968 | NPC141739 |
| Remote Similarity | 0.5968 | NPC181718 |
| Remote Similarity | 0.5968 | NPC599891 |
| Molecular Weight   | 337.2 |
| ALogP   | -0.5973 |
| MLogP   | 3.55 |
| XLogP   | 6.098 |
| HDA   | 2 |
| HBD   | 2 |
| Rotatable Bonds   | 9 |
| TPSA   | 41.49 |
| RO5 Violation   | 1 |