NPASS drugs

Drug Information

Drug ID:	NPD516
Drug Name:
Molecular Formula:	C11H13N5O3
Canonical SMILES:	OCC1=C[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N
Standard InCHI:	"InChI=1S/C11H13N5O3/c12-10-7-11(14-3-13-10)16(4-15-7)6-1-5(2-17)8(18)9(6)19/h1,3-4,6,8-9,17-19H,2H2,(H2,12,13,14)/t6-,8-,9+/m1/s1"
Standard InCHIKey:	XUGWUUDOWNZAGW-VDAHYXPESA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD516

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	171743
0.1-0.2	39219
0.2-0.3	455
0.3-0.4	233
0.4-0.5	84
0.5-0.6	4
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC571097
High Similarity	1.0	NPC608005
Remote Similarity	0.5965	NPC220660
Remote Similarity	0.5965	NPC93365
Remote Similarity	0.5965	NPC309267
Remote Similarity	0.5965	NPC607046

Drug Structure

NPD516 OpenBabel08201723202D 24 26 0 0 1 0 0 0 0 0999 V2000 -1.3849 -1.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0485 -1.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6092 -2.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4067 0.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3794 -1.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9781 -0.2079 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6092 -0.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5873 -0.0388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7213 0.4612 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4752 -0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -0.6691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3412 -0.1691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4752 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7431 -1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4013 0.8090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.0267 -1.5522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5009 0.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6168 1.4557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2072 -0.6691 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3412 0.8309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6958 -2.2953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3099 -0.2198 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7032 1.8625 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 5 2 0 0 0 0 2 5 1 0 0 0 0 2 17 1 0 0 0 0 3 13 2 0 0 0 0 3 14 1 0 0 0 0 4 15 2 0 0 0 0 4 16 1 0 0 0 0 5 8 1 0 0 0 0 6 1 1 6 0 0 0 6 9 1 0 0 0 0 6 16 1 0 0 0 0 7 10 2 0 0 0 0 7 11 1 0 0 0 0 7 15 1 0 0 0 0 8 9 1 0 0 0 0 8 18 1 1 0 0 0 9 19 1 1 0 0 0 10 12 1 0 0 0 0 10 13 1 0 0 0 0 11 14 2 0 0 0 0 11 16 1 0 0 0 0 12 20 1 0 0 0 0 12 21 1 0 0 0 0 17 22 1 0 0 0 0 18 23 1 0 0 0 0 19 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNC001008
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	72968
ChEBI
CAS Number

Drug Properties

Molecular Weight	263.1
ALogP	-1.985
MLogP	1.79
XLogP	-1.538
HDA	8
HBD	4
Rotatable Bonds	6
TPSA	130.31
RO5 Violation	0