Drug Information| Drug ID:   | NPD516 |
| Drug Name:   | |
| Molecular Formula:   | C11H13N5O3 |
| Canonical SMILES:   | OCC1=C[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N |
| Standard InCHI:   | "InChI=1S/C11H13N5O3/c12-10-7-11(14-3-13-10)16(4-15-7)6-1-5(2-17)8(18)9(6)19/h1,3-4,6,8-9,17-19H,2H2,(H2,12,13,14)/t6-,8-,9+/m1/s1" |
| Standard InCHIKey:   | XUGWUUDOWNZAGW-VDAHYXPESA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD516Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC571097 |
| High Similarity | 1.0 | NPC608005 |
| Remote Similarity | 0.5965 | NPC220660 |
| Remote Similarity | 0.5965 | NPC93365 |
| Remote Similarity | 0.5965 | NPC309267 |
| Remote Similarity | 0.5965 | NPC607046 |
| Molecular Weight   | 263.1 |
| ALogP   | -1.985 |
| MLogP   | 1.79 |
| XLogP   | -1.538 |
| HDA   | 8 |
| HBD   | 4 |
| Rotatable Bonds   | 6 |
| TPSA   | 130.31 |
| RO5 Violation   | 0 |