Drug Information| Drug ID:   | NPD5156 |
| Drug Name:   | Phenazocine |
| Molecular Formula:   | C22H27NO |
| Canonical SMILES:   | Oc1ccc2c(c1)C1(C)CCN(C(C2)C1C)CCc1ccccc1 |
| Standard InCHI:   | "InChI=1S/C22H27NO/c1-16-21-14-18-8-9-19(24)15-20(18)22(16,2)11-13-23(21)12-10-17-6-4-3-5-7-17/h3-9,15-16,21,24H,10-14H2,1-2H3" |
| Standard InCHIKey:   | ZQHYKVKNPWDQSL-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5156Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC259665 |
| High Similarity | 1.0 | NPC126859 |
| High Similarity | 1.0 | NPC89769 |
| High Similarity | 1.0 | NPC603520 |
| High Similarity | 1.0 | NPC607296 |
| Remote Similarity | 0.6949 | NPC99681 |
| Remote Similarity | 0.6949 | NPC66177 |
| Remote Similarity | 0.6949 | NPC268763 |
| Remote Similarity | 0.6949 | NPC310909 |
| Remote Similarity | 0.6949 | NPC8305 |
| Remote Similarity | 0.6949 | NPC609479 |
| Remote Similarity | 0.6949 | NPC609598 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 321.21 |
| ALogP   | 0.5049 |
| MLogP   | 3.66 |
| XLogP   | 6.578 |
| HDA   | 1 |
| HBD   | 1 |
| Rotatable Bonds   | 6 |
| TPSA   | 23.47 |
| RO5 Violation   | 1 |