NPASS drugs

Drug Information

Drug ID:	NPD5155
Drug Name:	Phenazocine Hydrobromide
Molecular Formula:	C22H27NO.BrH
Canonical SMILES:	Oc1ccc2c(c1)C1(C)CCN(C(C2)C1C)CCc1ccccc1.Br
Standard InCHI:	"InChI=1S/C22H27NO.BrH/c1-16-21-14-18-8-9-19(24)15-20(18)22(16,2)11-13-23(21)12-10-17-6-4-3-5-7-17;/h3-9,15-16,21,24H,10-14H2,1-2H3;1H"
Standard InCHIKey:	MNMGNPZLUMHSKK-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5155

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	135099
0.1-0.2	73762
0.2-0.3	2840
0.3-0.4	23
0.4-0.5	4
0.5-0.6	0
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	5

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9811	NPC259665
High Similarity	0.9811	NPC126859
High Similarity	0.9811	NPC89769
High Similarity	0.9811	NPC603520
High Similarity	0.9811	NPC607296
Remote Similarity	0.6833	NPC99681
Remote Similarity	0.6833	NPC66177
Remote Similarity	0.6833	NPC268763
Remote Similarity	0.6833	NPC310909
Remote Similarity	0.6833	NPC8305
Remote Similarity	0.6833	NPC609479
Remote Similarity	0.6833	NPC609598

Drug Structure

NPD5155 OpenBabel08211706322D 26 28 0 0 1 0 0 0 0 0999 V2000 6.6599 -3.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5616 -3.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7579 -0.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7578 -1.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9835 -0.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9833 -2.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2090 -0.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7871 -1.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0124 -1.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4344 -2.2514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1106 -3.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6601 -1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8854 -3.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3366 -1.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7871 -3.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1108 -2.6985 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 8.2089 -1.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5617 -1.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0124 -2.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5617 -2.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1112 -1.8039 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 4.3363 -3.1456 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 5.8856 -2.2512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2378 -3.1454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7395 -1.2333 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 0.4632 -2.6982 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 16 1 0 0 0 0 2 22 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 17 2 0 0 0 0 7 17 1 0 0 0 0 8 9 2 0 0 0 0 8 18 1 0 0 0 0 9 19 1 0 0 0 0 10 12 1 0 0 0 0 10 17 1 0 0 0 0 11 13 1 0 0 0 0 11 22 1 0 0 0 0 12 23 1 0 0 0 0 13 23 1 0 0 0 0 14 18 1 0 0 0 0 14 21 1 0 0 0 0 15 19 2 0 0 0 0 15 20 1 0 0 0 0 16 21 1 0 0 0 0 16 22 1 0 0 0 0 18 20 2 0 0 0 0 19 24 1 0 0 0 0 20 22 1 0 0 0 0 21 23 1 0 0 0 0 24 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	321.21
ALogP	0.5049
MLogP	3.66
XLogP	6.578
HDA	1
HBD	1
Rotatable Bonds	6
TPSA	23.47
RO5 Violation	1