NPASS drugs

Drug Information

Drug ID:	NPD514
Drug Name:
Molecular Formula:	C11H13N3O5
Canonical SMILES:	OC[C@H]1O[C@@H]([C@@H]([C@@]1(O)C#C)O)n1ccc(=N)nc1O
Standard InCHI:	"InChI=1S/C11H13N3O5/c1-2-11(18)6(5-15)19-9(8(11)16)14-4-3-7(12)13-10(14)17/h1,3-4,6,8-9,15-16,18H,5H2,(H2,12,13,17)/t6-,8+,9+,11-/m1/s1"
Standard InCHIKey:	JFIWEPHGRUDAJN-XAWUEOSKSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD514

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	126753
0.1-0.2	84452
0.2-0.3	493
0.3-0.4	19
0.4-0.5	13
0.5-0.6	9
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6471	NPC62927
Remote Similarity	0.5741	NPC229249
Remote Similarity	0.5741	NPC140420
Remote Similarity	0.5593	NPC6166
Remote Similarity	0.5556	NPC487916
Remote Similarity	0.5536	NPC480848
Remote Similarity	0.5333	NPC280946
Remote Similarity	0.5238	NPC90240
Remote Similarity	0.5082	NPC226769
Remote Similarity	0.5077	NPC120887

Drug Structure

NPD514 OpenBabel08201723202D 24 25 0 0 1 0 0 0 0 0999 V2000 -4.0667 0.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2577 -0.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3554 -2.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9487 -1.7024 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7796 -0.0933 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4487 -0.8364 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.3500 -2.7205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9875 0.8849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3622 -1.2431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9706 -1.4945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9377 -1.9115 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9385 1.1939 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1713 -0.6554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 3 0 0 0 0 3 4 2 0 0 0 0 3 7 1 0 0 0 0 4 14 1 0 0 0 0 5 6 1 0 0 0 0 5 15 1 0 0 0 0 6 11 1 6 0 0 0 6 19 1 0 0 0 0 7 12 2 0 0 0 0 7 13 1 0 0 0 0 8 9 1 0 0 0 0 8 11 1 1 0 0 0 8 16 1 0 0 0 0 9 14 1 1 0 0 0 9 19 1 0 0 0 0 10 13 2 0 0 0 0 10 14 1 0 0 0 0 10 17 1 0 0 0 0 11 2 1 6 0 0 0 11 18 1 0 0 0 0 12 20 1 0 0 0 0 15 21 1 0 0 0 0 16 22 1 0 0 0 0 17 23 1 0 0 0 0 18 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL002622
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	56841052
ChEBI
CAS Number

Drug Properties

Molecular Weight	267.09
ALogP	-1.8579
MLogP	1.79
XLogP	-0.585
HDA	8
HBD	5
Rotatable Bonds	6
TPSA	129.6
RO5 Violation	0