NPASS drugs

Drug Information

Drug ID:	NPD5090
Drug Name:	Colchicine
Molecular Formula:	C22H25NO6
Canonical SMILES:	COc1c(OC)cc2c(c1OC)c1ccc(c(=O)cc1[C@H](CC2)N=C(O)C)OC
Standard InCHI:	"InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1"
Standard InCHIKey:	IAKHMKGGTNLKSZ-INIZCTEOSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD5090

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	118831
0.1-0.2	89880
0.2-0.3	2872
0.3-0.4	122
0.4-0.5	4
0.5-0.6	19
0.6-0.7	2
0.7-0.8	4
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC108957
High Similarity	1.0	NPC14005
High Similarity	1.0	NPC226941
Intermediate Similarity	0.8387	NPC120215
Intermediate Similarity	0.8387	NPC189782
Intermediate Similarity	0.8136	NPC44642
Intermediate Similarity	0.7302	NPC66678
Intermediate Similarity	0.7188	NPC202839
Intermediate Similarity	0.7105	NPC54962
Intermediate Similarity	0.7077	NPC49550
Remote Similarity	0.6974	NPC219475
Remote Similarity	0.6232	NPC290536
Remote Similarity	0.597	NPC511909
Remote Similarity	0.597	NPC600699
Remote Similarity	0.597	NPC609718
Remote Similarity	0.597	NPC611997
Remote Similarity	0.5814	NPC13480
Remote Similarity	0.5797	NPC3960
Remote Similarity	0.5781	NPC571857
Remote Similarity	0.5781	NPC600354
Remote Similarity	0.5758	NPC218575
Remote Similarity	0.5758	NPC301939
Remote Similarity	0.5606	NPC190931
Remote Similarity	0.5556	NPC517898
Remote Similarity	0.5556	NPC604863
Remote Similarity	0.5522	NPC556008
Remote Similarity	0.5522	NPC612015
Remote Similarity	0.5507	NPC515843
Remote Similarity	0.5278	NPC576135
Remote Similarity	0.5067	NPC324720
Remote Similarity	0.5067	NPC588014

Drug Structure

NPD5090 OpenBabel08211706322D 30 32 0 0 1 0 0 0 0 0999 V2000 -2.6623 -3.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3497 0.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0151 -2.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4942 -0.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3349 -3.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4914 -0.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1565 -2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1623 -4.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9309 -1.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2256 -2.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6623 -3.1472 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0225 -2.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1716 -1.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1623 -4.0132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.6623 -4.8792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8488 -2.7496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1271 -0.9027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6623 -4.8792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 2 26 1 0 0 0 0 3 27 1 0 0 0 0 4 28 1 0 0 0 0 5 29 1 0 0 0 0 6 8 1 0 0 0 0 6 13 1 0 0 0 0 7 9 1 0 0 0 0 7 14 2 0 0 0 0 8 16 1 0 0 0 0 9 18 2 0 0 0 0 10 13 2 0 0 0 0 10 19 1 0 0 0 0 11 15 2 0 0 0 0 11 17 1 0 0 0 0 12 23 2 3 0 0 0 12 24 1 0 0 0 0 13 20 1 0 0 0 0 14 15 1 0 0 0 0 14 20 1 0 0 0 0 15 16 1 0 0 0 0 16 23 1 6 0 0 0 17 18 1 0 0 0 0 17 25 2 0 0 0 0 18 26 1 0 0 0 0 19 21 2 0 0 0 0 19 27 1 0 0 0 0 20 22 2 0 0 0 0 21 22 1 0 0 0 0 21 28 1 0 0 0 0 22 29 1 0 0 0 0 24 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001254
DrugBank
ChEMBL
IUPHAR/BPS	2367
PharmaGKB
KEGG Drug
PubChem CID	6167
ChEBI
CAS Number

Drug Properties

Molecular Weight	399.17
ALogP	-0.4721
MLogP	3.11
XLogP	1.463
HDA	4
HBD	1
Rotatable Bonds	11
TPSA	86.58
RO5 Violation	0