Drug Information| Drug ID:   | NPD5090 |
| Drug Name:   | Colchicine |
| Molecular Formula:   | C22H25NO6 |
| Canonical SMILES:   | COc1c(OC)cc2c(c1OC)c1ccc(c(=O)cc1[C@H](CC2)N=C(O)C)OC |
| Standard InCHI:   | "InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m0/s1" |
| Standard InCHIKey:   | IAKHMKGGTNLKSZ-INIZCTEOSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD5090Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC108957 |
| High Similarity | 1.0 | NPC14005 |
| High Similarity | 1.0 | NPC226941 |
| Intermediate Similarity | 0.8387 | NPC120215 |
| Intermediate Similarity | 0.8387 | NPC189782 |
| Intermediate Similarity | 0.8136 | NPC44642 |
| Intermediate Similarity | 0.7302 | NPC66678 |
| Intermediate Similarity | 0.7188 | NPC202839 |
| Intermediate Similarity | 0.7105 | NPC54962 |
| Intermediate Similarity | 0.7077 | NPC49550 |
| Remote Similarity | 0.6974 | NPC219475 |
| Remote Similarity | 0.6232 | NPC290536 |
| Remote Similarity | 0.597 | NPC511909 |
| Remote Similarity | 0.597 | NPC600699 |
| Remote Similarity | 0.597 | NPC609718 |
| Remote Similarity | 0.597 | NPC611997 |
| Remote Similarity | 0.5814 | NPC13480 |
| Remote Similarity | 0.5797 | NPC3960 |
| Remote Similarity | 0.5781 | NPC571857 |
| Remote Similarity | 0.5781 | NPC600354 |
| Remote Similarity | 0.5758 | NPC218575 |
| Remote Similarity | 0.5758 | NPC301939 |
| Remote Similarity | 0.5606 | NPC190931 |
| Remote Similarity | 0.5556 | NPC517898 |
| Remote Similarity | 0.5556 | NPC604863 |
| Remote Similarity | 0.5522 | NPC556008 |
| Remote Similarity | 0.5522 | NPC612015 |
| Remote Similarity | 0.5507 | NPC515843 |
| Remote Similarity | 0.5278 | NPC576135 |
| Remote Similarity | 0.5067 | NPC324720 |
| Remote Similarity | 0.5067 | NPC588014 |
| Molecular Weight   | 399.17 |
| ALogP   | -0.4721 |
| MLogP   | 3.11 |
| XLogP   | 1.463 |
| HDA   | 4 |
| HBD   | 1 |
| Rotatable Bonds   | 11 |
| TPSA   | 86.58 |
| RO5 Violation   | 0 |