Drug Information| Drug ID:   | NPD5075 |
| Drug Name:   | VA-045 |
| Molecular Formula:   | C22H25N3O5 |
| Canonical SMILES:   | CC[C@]12CCCN3[C@@H]2c2n(C(=C1)C(=O)OCCON(=O)=O)c1c(c2CC3)cccc1 |
| Standard InCHI:   | "InChI=1S/C22H25N3O5/c1-2-22-9-5-10-23-11-8-16-15-6-3-4-7-17(15)24(19(16)20(22)23)18(14-22)21(26)29-12-13-30-25(27)28/h3-4,6-7,14,20H,2,5,8-13H2,1H3/t20-,22+/m1/s1" |
| Standard InCHIKey:   | VDHLDQHKSSLLJV-IRLDBZIGSA-N |
| Max Developmental Stage:   | Discontinued |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5075Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7625 | NPC506378 |
| Intermediate Similarity | 0.7625 | NPC600530 |
| Remote Similarity | 0.5349 | NPC20144 |
| Remote Similarity | 0.5349 | NPC161520 |
| Remote Similarity | 0.5056 | NPC194881 |
| Remote Similarity | 0.5056 | NPC228710 |
| Remote Similarity | 0.5056 | NPC547924 |
| Remote Similarity | 0.5056 | NPC611876 |
| Molecular Weight   | 411.18 |
| ALogP   | -0.0948 |
| MLogP   | 3 |
| XLogP   | 4.936 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 8 |
| TPSA   | 89.52 |
| RO5 Violation   | 0 |