NPASS drugs

Drug Information

Drug ID:	NPD499
Drug Name:	Epacadostat
Molecular Formula:	C11H13BrFN7O4S
Canonical SMILES:	ONC(=Nc1ccc(c(c1)Br)F)c1nonc1NCCNS(=O)(=O)N
Standard InCHI:	InChI=1S/C11H13BrFN7O4S/c12-7-5-6(1-2-8(7)13)17-11(18-21)9-10(20-24-19-9)15-3-4-16-25(14,22)23/h1-2,5,16,21H,3-4H2,(H,15,20)(H,17,18)(H2,14,22,23)
Standard InCHIKey:	FBKMWOJEPMPVTQ-UHFFFAOYSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD499

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	1899
0.1-0.2	11557
0.2-0.3	12550
0.3-0.4	2769
0.4-0.5	1757
0.5-0.6	341
0.6-0.7	17
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6778	NPC108011
Remote Similarity	0.6552	NPC247987
Remote Similarity	0.64	NPC253687
Remote Similarity	0.6393	NPC307191
Remote Similarity	0.6389	NPC313362
Remote Similarity	0.638	NPC216159
Remote Similarity	0.625	NPC42483
Remote Similarity	0.6243	NPC232798
Remote Similarity	0.6145	NPC17751
Remote Similarity	0.6114	NPC120070
Remote Similarity	0.6069	NPC2272
Remote Similarity	0.6056	NPC274229
Remote Similarity	0.6034	NPC225018
Remote Similarity	0.6033	NPC317054
Remote Similarity	0.6012	NPC114209
Remote Similarity	0.6011	NPC82331
Remote Similarity	0.6	NPC474958
Remote Similarity	0.5988	NPC204141
Remote Similarity	0.5967	NPC280864
Remote Similarity	0.5966	NPC141926
Remote Similarity	0.5928	NPC477166
Remote Similarity	0.5928	NPC473342
Remote Similarity	0.5928	NPC477167
Remote Similarity	0.5928	NPC304187
Remote Similarity	0.5912	NPC206148
Remote Similarity	0.5897	NPC474180
Remote Similarity	0.5897	NPC188821
Remote Similarity	0.5889	NPC470204
Remote Similarity	0.5886	NPC282531
Remote Similarity	0.5866	NPC236711
Remote Similarity	0.5862	NPC317642
Remote Similarity	0.586	NPC280297
Remote Similarity	0.5858	NPC125746
Remote Similarity	0.5856	NPC470203
Remote Similarity	0.5824	NPC476418
Remote Similarity	0.5792	NPC2165
Remote Similarity	0.5784	NPC97343
Remote Similarity	0.5779	NPC474389
Remote Similarity	0.5775	NPC97106
Remote Similarity	0.5771	NPC316069
Remote Similarity	0.5756	NPC115611
Remote Similarity	0.5754	NPC476219
Remote Similarity	0.5754	NPC34844
Remote Similarity	0.5754	NPC476297
Remote Similarity	0.5746	NPC300238
Remote Similarity	0.5745	NPC315715
Remote Similarity	0.5745	NPC136441
Remote Similarity	0.5743	NPC469716
Remote Similarity	0.5722	NPC477611
Remote Similarity	0.5714	NPC122141
Remote Similarity	0.5705	NPC474430
Remote Similarity	0.5676	NPC109447
Remote Similarity	0.567	NPC63571
Remote Similarity	0.5668	NPC227489
Remote Similarity	0.5668	NPC476421
Remote Similarity	0.5668	NPC54214
Remote Similarity	0.5668	NPC28096
Remote Similarity	0.5663	NPC231536
Remote Similarity	0.5652	NPC149265
Remote Similarity	0.5642	NPC156003
Remote Similarity	0.5641	NPC310633
Remote Similarity	0.5638	NPC314557
Remote Similarity	0.5636	NPC75999
Remote Similarity	0.5622	NPC195507
Remote Similarity	0.5614	NPC325252
Remote Similarity	0.5614	NPC218268

Drug Structure

NPD499 OpenBabel08201723202D 31 32 0 0 0 0 0 0 0 0999 V2000 -5.3942 -3.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3453 -3.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8590 -2.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6511 -2.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8101 -1.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5532 -2.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5411 -4.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4921 -4.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0180 -0.7263 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 -7.5043 -2.0646 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.7000 -3.3006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.2353 -4.9479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.2321 -5.5388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9230 -4.5878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1863 -4.6389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2321 -5.5388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0274 -5.9260 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9295 -5.3080 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 6 1 0 0 0 0 2 8 1 0 0 0 0 3 4 1 0 0 0 0 3 15 1 0 0 0 0 4 16 1 0 0 0 0 5 6 2 0 0 0 0 5 7 1 0 0 0 0 6 17 1 0 0 0 0 7 8 2 0 0 0 0 7 12 1 0 0 0 0 8 13 1 0 0 0 0 9 10 1 0 0 0 0 9 11 1 0 0 0 0 9 19 2 0 0 0 0 10 15 1 0 0 0 0 10 20 2 0 0 0 0 11 17 2 3 0 0 0 11 18 1 0 0 0 0 14 25 1 0 0 0 0 14 26 1 0 0 0 0 14 27 1 0 0 0 0 15 28 1 0 0 0 0 16 25 1 0 0 0 0 16 29 1 0 0 0 0 18 21 1 0 0 0 0 18 30 1 0 0 0 0 19 24 1 0 0 0 0 20 24 1 0 0 0 0 21 31 1 0 0 0 0 22 25 2 0 0 0 0 23 25 2 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	436.99
ALogP	-1.5675
MLogP	1.13
XLogP	0.455
HDA	6
HBD	5
Rotatable Bonds	12
TPSA	176.14
RO5 Violation	0