Drug Information| Drug ID:   | NPD4961 |
| Drug Name:   | Ceftazidime Sodium |
| Molecular Formula:   | C22H22N6O7S2.Na |
| Canonical SMILES:   | O=C1[C@@H](N=C(/C(=NOC(C(=O)[O-])(C)C)/c2csc(=N)[nH]2)[O-])[C@@H]2N1C(=C(CS2)C[n+]1ccccc1)C(=O)O.[Na+] |
| Standard InCHI:   | "InChI=1S/C22H22N6O7S2.Na/c1-22(2,20(33)34)35-26-13(12-10-37-21(23)24-12)16(29)25-14-17(30)28-15(19(31)32)11(9-36-18(14)28)8-27-6-4-3-5-7-27;/h3-7,10,14,18H,8-9H2,1-2H3,(H4-,23,24,25,29,31,32,33,34);/q;+1/p-1/b26-13-;/t14-,18-;/m1./s1" |
| Standard InCHIKey:   | JEEWDSDYUSEQML-ROMZVAKDSA-M |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4961Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 545.09 |
| ALogP   | -3.1144 |
| MLogP   | 2.23 |
| XLogP   | 1.613 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 14 |
| TPSA   | 245.11 |
| RO5 Violation   | 0 |