Drug Information| Drug ID:   | NPD4870 |
| Drug Name:   | Deltamethrin |
| Molecular Formula:   | C22H19Br2NO3 |
| Canonical SMILES:   | N#C[C@H](c1cccc(c1)Oc1ccccc1)OC(=O)[C@@H]1[C@@H](C1(C)C)C=C(Br)Br |
| Standard InCHI:   | "InChI=1S/C22H19Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m0/s1" |
| Standard InCHIKey:   | OWZREIFADZCYQD-NSHGMRRFSA-N |
| Max Developmental Stage:   | Pre-clinical |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4870Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC322552 |
| High Similarity | 1.0 | NPC251849 |
| Remote Similarity | 0.6491 | NPC320287 |
| Remote Similarity | 0.6491 | NPC611687 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 502.97 |
| ALogP   | 1.9373 |
| MLogP   | 3.22 |
| XLogP   | 7.261 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 11 |
| TPSA   | 59.32 |
| RO5 Violation   | 1 |