Drug Information| Drug ID:   | NPD4780 |
| Drug Name:   | |
| Molecular Formula:   | C21H32N4O6 |
| Canonical SMILES:   | O=C([C@@H]1CO1)CCCCC[C@@H]1N=C(O)C(C)N=C(O)[C@@H](N=C([C@@H]2N(C1=O)CCC2)O)C |
| Standard InCHI:   | "InChI=1S/C21H32N4O6/c1-12-18(27)22-13(2)19(28)24-14(7-4-3-5-9-16(26)17-11-31-17)21(30)25-10-6-8-15(25)20(29)23-12/h12-15,17H,3-11H2,1-2H3,(H,22,27)(H,23,29)(H,24,28)/t12-,13?,14-,15+,17-/m0/s1" |
| Standard InCHIKey:   | GNYCTMYOHGBSBI-LFLYSQGHSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4780Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6377 | NPC248283 |
| Remote Similarity | 0.5094 | NPC161774 |
| Remote Similarity | 0.5094 | NPC256312 |
| Remote Similarity | 0.5094 | NPC266888 |
| Remote Similarity | 0.5094 | NPC10529 |
| Remote Similarity | 0.5094 | NPC33707 |
| Molecular Weight   | 436.23 |
| ALogP   | -3.6504 |
| MLogP   | 2.67 |
| XLogP   | -0.043 |
| HDA   | 10 |
| HBD   | 3 |
| Rotatable Bonds   | 12 |
| TPSA   | 147.68 |
| RO5 Violation   | 0 |