NPASS drugs

Drug Information

Drug ID:	NPD4764
Drug Name:	Buspirone Hydrochloride
Molecular Formula:	C21H31N5O2.ClH
Canonical SMILES:	O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCN(CC1)c1ncccn1.Cl
Standard InCHI:	InChI=1S/C21H31N5O2.ClH/c27-18-16-21(6-1-2-7-21)17-19(28)26(18)11-4-3-10-24-12-14-25(15-13-24)20-22-8-5-9-23-20;/h5,8-9H,1-4,6-7,10-17H2;1H
Standard InCHIKey:	RICLFGYGYQXUFH-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4764

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	276
0.1-0.2	15546
0.2-0.3	11138
0.3-0.4	2437
0.4-0.5	1363
0.5-0.6	125
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6406	NPC326364
Remote Similarity	0.6074	NPC476128
Remote Similarity	0.6071	NPC472833
Remote Similarity	0.6059	NPC472832
Remote Similarity	0.6059	NPC18308
Remote Similarity	0.5986	NPC27699
Remote Similarity	0.5845	NPC222061
Remote Similarity	0.5802	NPC76544
Remote Similarity	0.5802	NPC226184
Remote Similarity	0.5802	NPC167285
Remote Similarity	0.5767	NPC65408
Remote Similarity	0.5753	NPC477120
Remote Similarity	0.5699	NPC477118
Remote Similarity	0.5663	NPC476521
Remote Similarity	0.5659	NPC164845
Remote Similarity	0.5644	NPC296437
Remote Similarity	0.5636	NPC476528
Remote Similarity	0.5636	NPC476433
Remote Similarity	0.5629	NPC197068
Remote Similarity	0.5625	NPC163105
Remote Similarity	0.561	NPC470266
Remote Similarity	0.5602	NPC476013
Remote Similarity	0.5602	NPC476522
Remote Similarity	0.5602	NPC476520
Remote Similarity	0.5602	NPC474986

Drug Structure

NPD4764 OpenBabel08211705272D 29 31 0 0 0 0 0 0 0 0999 V2000 8.7942 -5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 -5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1032 -4.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4852 -4.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1603 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1603 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0263 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4649 -3.8366 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 1 0 0 0 0 2 7 1 0 0 0 0 3 4 1 0 0 0 0 3 10 1 0 0 0 0 4 11 1 0 0 0 0 5 8 2 0 0 0 0 5 9 1 0 0 0 0 6 21 1 0 0 0 0 7 21 1 0 0 0 0 8 22 1 0 0 0 0 9 23 2 0 0 0 0 10 24 1 0 0 0 0 11 26 1 0 0 0 0 12 14 1 0 0 0 0 12 24 1 0 0 0 0 13 15 1 0 0 0 0 13 24 1 0 0 0 0 14 25 1 0 0 0 0 15 25 1 0 0 0 0 16 18 1 0 0 0 0 16 21 1 0 0 0 0 17 19 1 0 0 0 0 17 21 1 0 0 0 0 18 26 1 0 0 0 0 18 27 2 0 0 0 0 19 26 1 0 0 0 0 19 28 2 0 0 0 0 20 22 2 0 0 0 0 20 23 1 0 0 0 0 20 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	385.25
ALogP	-1.9897
MLogP	3
XLogP	2.154
HDA	7
HBD	0
Rotatable Bonds	6
TPSA	69.64
RO5 Violation	0