Drug Information| Drug ID:   | NPD4727 |
| Drug Name:   | GCC-1290K |
| Molecular Formula:   | C21H29NO4 |
| Canonical SMILES:   | CC(OC(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@@H]3[C@H](C2)NCC1)C |
| Standard InCHI:   | "InChI=1S/C21H29NO4/c1-14(2)26-20(23)25-13-24-16-7-6-15-11-19-17-5-3-4-8-21(17,9-10-22-19)18(15)12-16/h6-7,12,14,17,19,22H,3-5,8-11,13H2,1-2H3/t17-,19+,21+/m1/s1" |
| Standard InCHIKey:   | XUUSKRFBAUMDGN-LMNJBCLMSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4727Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 359.21 |
| ALogP   | -0.7118 |
| MLogP   | 3.22 |
| XLogP   | 5.19 |
| HDA   | 4 |
| HBD   | 1 |
| Rotatable Bonds   | 8 |
| TPSA   | 56.79 |
| RO5 Violation   | 1 |