Drug Information| Drug ID:   | NPD47 |
| Drug Name:   | Calcium Acetate |
| Molecular Formula:   | 2C2H4O2.Ca |
| Canonical SMILES:   | [O-]C(=O)C.[O-]C(=O)C.[Ca+2] |
| Standard InCHI:   | "InChI=1S/2C2H4O2.Ca/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2" |
| Standard InCHIKey:   | VSGNNIFQASZAOI-UHFFFAOYSA-L |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD47Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC68874 |
| High Similarity | 1.0 | NPC327795 |
| Remote Similarity | 0.625 | NPC251720 |
| Remote Similarity | 0.6 | NPC284970 |
| Remote Similarity | 0.6 | NPC238637 |
| Remote Similarity | 0.6 | NPC314277 |
| Remote Similarity | 0.6 | NPC325390 |
| Remote Similarity | 0.6 | NPC242626 |
| Remote Similarity | 0.6 | NPC324351 |
| Remote Similarity | 0.5455 | NPC327963 |
| Remote Similarity | 0.5455 | NPC169697 |
| Remote Similarity | 0.5455 | NPC89025 |
| Remote Similarity | 0.5455 | NPC165123 |
| Remote Similarity | 0.5455 | NPC213481 |
| Remote Similarity | 0.5455 | NPC313620 |
| Remote Similarity | 0.5455 | NPC323552 |
| Remote Similarity | 0.5455 | NPC565790 |
| TTD   | |
| DrugBank   | DB00258 |
| ChEMBL   | CHEMBL1200800 |
| IUPHAR/BPS   | |
| PharmaGKB   | PA164746897 |
| KEGG Drug   | D00931 |
| PubChem CID   | 0 |
| ChEBI   | 3310 |
| CAS Number   | 62-54-4 |
| Molecular Weight   | 59.01 |
| ALogP   | -0.9077 |
| MLogP   | 1.46 |
| XLogP   | -0.561 |
| HDA   | 2 |
| HBD   | 0 |
| Rotatable Bonds   | 2 |
| TPSA   | 40.13 |
| RO5 Violation   | 0 |