NPASS drugs

Drug Information

Drug ID:	NPD4665
Drug Name:	Nalbuphine
Molecular Formula:	C21H27NO4
Canonical SMILES:	O[C@H]1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CCC2)ccc1O)O
Standard InCHI:	"InChI=1S/C21H27NO4/c23-14-5-4-13-10-16-21(25)7-6-15(24)19-20(21,17(13)18(14)26-19)8-9-22(16)11-12-2-1-3-12/h4-5,12,15-16,19,23-25H,1-3,6-11H2/t15-,16+,19-,20-,21+/m0/s1"
Standard InCHIKey:	NETZHAKZCGBWSS-CEDHKZHLSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4665

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	72424
0.1-0.2	136293
0.2-0.3	2959
0.3-0.4	41
0.4-0.5	13
0.5-0.6	9
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7162	NPC611959
Remote Similarity	0.5897	NPC254045
Remote Similarity	0.5897	NPC201055
Remote Similarity	0.5897	NPC265000
Remote Similarity	0.5897	NPC64576
Remote Similarity	0.5897	NPC151470
Remote Similarity	0.5897	NPC603205
Remote Similarity	0.5897	NPC603486
Remote Similarity	0.5897	NPC611632
Remote Similarity	0.5316	NPC97086

Drug Structure

NPD4665 OpenBabel08211705262D 29 34 0 0 1 0 0 0 0 0999 V2000 -0.0000 -0.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8372 -0.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0392 1.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8479 1.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8880 -1.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6713 -0.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8554 0.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8300 1.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6385 1.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4293 0.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8372 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4472 0.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0646 0.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6967 -1.8341 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0467 0.5920 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6639 0.1584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4726 -0.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2888 -1.2421 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0721 -0.4334 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2634 -0.2167 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2380 0.8087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.8733 0.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9134 -2.6429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4547 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3784 -1.1477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2422 1.0686 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6940 -2.9457 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0520 -0.7341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 3 1 0 0 0 0 2 12 1 0 0 0 0 3 12 1 0 0 0 0 4 5 2 0 0 0 0 4 13 1 0 0 0 0 5 14 1 0 0 0 0 6 7 1 0 0 0 0 6 15 1 0 0 0 0 7 21 1 0 0 0 0 8 9 1 0 0 0 0 8 20 1 0 0 0 0 9 22 1 0 0 0 0 10 13 1 0 0 0 0 10 16 1 0 0 0 0 11 12 1 0 0 0 0 11 22 1 0 0 0 0 13 17 2 0 0 0 0 14 18 2 0 0 0 0 14 23 1 0 0 0 0 15 19 1 0 0 0 0 15 24 1 1 0 0 0 16 21 1 6 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 20 1 0 0 0 0 18 26 1 0 0 0 0 19 20 1 1 0 0 0 19 26 1 0 0 0 0 20 21 1 1 0 0 0 21 25 1 6 0 0 0 23 27 1 0 0 0 0 24 28 1 0 0 0 0 25 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000380; DIB008334; DIB016192
DrugBank	DB00844
ChEMBL	CHEMBL895
IUPHAR/BPS	1663
PharmaGKB	PA164745372
KEGG Drug	D08246
PubChem CID	5360733
ChEBI	7454
CAS Number	20594-83-6

Drug Properties

Molecular Weight	357.19
ALogP	-1.6392
MLogP	3.22
XLogP	0.763
HDA	5
HBD	3
Rotatable Bonds	5
TPSA	73.16
RO5 Violation	0