Drug Information| Drug ID:   | NPD4652 |
| Drug Name:   | |
| Molecular Formula:   | C21H27N5O7S |
| Canonical SMILES:   | CN=C(C[C@H](C(=N[C@H](c1ccc(cc1)O)C(=N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C)O)O)N)O |
| Standard InCHI:   | "InChI=1S/C21H27N5O7S/c1-21(2)15(20(32)33)26-18(31)14(19(26)34-21)25-17(30)13(9-4-6-10(27)7-5-9)24-16(29)11(22)8-12(28)23-3/h4-7,11,13-15,19,27H,8,22H2,1-3H3,(H,23,28)(H,24,29)(H,25,30)(H,32,33)/t11-,13-,14-,15+,19-/m1/s1" |
| Standard InCHIKey:   | BHELIUBJHYAEDK-OAIUPTLZSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4652Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNAP001511 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 71961 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 493.16 |
| ALogP   | -1.8403 |
| MLogP   | 2.34 |
| XLogP   | -2.772 |
| HDA   | 11 |
| HBD   | 6 |
| Rotatable Bonds   | 17 |
| TPSA   | 226.93 |
| RO5 Violation   | 2 |