NPASS drugs

Drug Information

Drug ID:	NPD4624
Drug Name:	Mestranol
Molecular Formula:	C21H26O2
Canonical SMILES:	C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)OC
Standard InCHI:	"InChI=1S/C21H26O2/c1-4-21(22)12-10-19-18-7-5-14-13-15(23-3)6-8-16(14)17(18)9-11-20(19,21)2/h1,6,8,13,17-19,22H,5,7,9-12H2,2-3H3/t17-,18-,19+,20+,21+/m1/s1"
Standard InCHIKey:	IMSSROKUHAOUJS-MJCUULBUSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4624

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	58428
0.1-0.2	147320
0.2-0.3	5897
0.3-0.4	62
0.4-0.5	27
0.5-0.6	1
0.6-0.7	5
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6562	NPC99734
Remote Similarity	0.6562	NPC611911
Remote Similarity	0.625	NPC498325
Remote Similarity	0.6154	NPC33900
Remote Similarity	0.6154	NPC575904
Remote Similarity	0.5362	NPC220771

Drug Structure

NPD4624 OpenBabel08211705262D 24 27 0 0 1 0 0 0 0 0999 V2000 -0.7226 1.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8423 0.5219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3822 -2.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5282 -3.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0539 -1.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6857 -2.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2119 -1.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5274 -0.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8408 -1.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6848 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8411 -0.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2125 -3.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 -2.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0542 -2.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3702 -1.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5277 -1.4577 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6854 -1.9443 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8428 -1.4582 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8426 -0.4861 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8417 0.4856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8963 -3.4020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7657 0.1850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 3 0 0 0 0 2 20 1 0 0 0 0 3 23 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 6 8 1 0 0 0 0 6 15 2 0 0 0 0 8 16 2 0 0 0 0 9 11 1 0 0 0 0 10 12 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 21 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 14 16 1 0 0 0 0 15 23 1 0 0 0 0 16 17 1 0 0 0 0 17 9 1 6 0 0 0 17 18 1 0 0 0 0 18 7 1 1 0 0 0 18 19 1 0 0 0 0 19 20 1 6 0 0 0 20 21 1 1 0 0 0 21 4 1 1 0 0 0 21 22 1 0 0 0 0 22 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001014
DrugBank	DB01357
ChEMBL	CHEMBL1201151
IUPHAR/BPS	7087
PharmaGKB	PA450388
KEGG Drug	D00575
PubChem CID	6291
ChEBI	6784
CAS Number	72-33-3

Drug Properties

Molecular Weight	310.19
ALogP	1.0126
MLogP	3.55
XLogP	5.186
HDA	1
HBD	1
Rotatable Bonds	4
TPSA	29.46
RO5 Violation	1