NPASS drugs

Drug Information

Drug ID:	NPD4602
Drug Name:	Vincamine
Molecular Formula:	C21H26N2O3
Canonical SMILES:	COC(=O)[C@@]1(O)C[C@]2(CC)CCCN3[C@@H]2c2n1c1ccccc1c2CC3
Standard InCHI:	"InChI=1S/C21H26N2O3/c1-3-20-10-6-11-22-12-9-15-14-7-4-5-8-16(14)23(17(15)18(20)22)21(25,13-20)19(24)26-2/h4-5,7-8,18,25H,3,6,9-13H2,1-2H3/t18-,20+,21+/m1/s1"
Standard InCHIKey:	RXPRRQLKFXBCSJ-GIVPXCGWSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4602

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	58480
0.1-0.2	151185
0.2-0.3	1925
0.3-0.4	69
0.4-0.5	34
0.5-0.6	24
0.6-0.7	12
0.7-0.8	4
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	5

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC3191
High Similarity	1.0	NPC289299
High Similarity	1.0	NPC255552
High Similarity	1.0	NPC564694
High Similarity	1.0	NPC611897
Intermediate Similarity	0.831	NPC588120
Intermediate Similarity	0.7973	NPC30671
Intermediate Similarity	0.7973	NPC541672
Intermediate Similarity	0.7013	NPC229888
Intermediate Similarity	0.7013	NPC63807
Remote Similarity	0.6709	NPC558271
Remote Similarity	0.64	NPC81229
Remote Similarity	0.64	NPC255229
Remote Similarity	0.64	NPC207129
Remote Similarity	0.64	NPC175688
Remote Similarity	0.6267	NPC194881
Remote Similarity	0.6267	NPC26775
Remote Similarity	0.6267	NPC230235
Remote Similarity	0.6267	NPC160889
Remote Similarity	0.6267	NPC228710
Remote Similarity	0.6267	NPC547924
Remote Similarity	0.6267	NPC611876
Remote Similarity	0.5976	NPC535063
Remote Similarity	0.5949	NPC229460
Remote Similarity	0.5926	NPC506378
Remote Similarity	0.5926	NPC531228
Remote Similarity	0.5926	NPC536816
Remote Similarity	0.5926	NPC600530
Remote Similarity	0.5769	NPC236897
Remote Similarity	0.5714	NPC512721
Remote Similarity	0.5696	NPC125963
Remote Similarity	0.5696	NPC564248
Remote Similarity	0.5647	NPC201293
Remote Similarity	0.5647	NPC222400
Remote Similarity	0.5647	NPC593593
Remote Similarity	0.557	NPC133261
Remote Similarity	0.5517	NPC483942
Remote Similarity	0.5517	NPC483943
Remote Similarity	0.5488	NPC135078
Remote Similarity	0.5385	NPC20144
Remote Similarity	0.5385	NPC161520
Remote Similarity	0.5357	NPC483479
Remote Similarity	0.5333	NPC496400
Remote Similarity	0.5309	NPC483478
Remote Similarity	0.5309	NPC531719
Remote Similarity	0.5181	NPC503829

Drug Structure

NPD4602 OpenBabel08211705262D 27 31 0 0 1 0 0 0 0 0999 V2000 -2.9354 -1.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2291 2.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3143 -0.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3408 -0.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3410 -0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1604 -2.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5057 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5061 0.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8345 -2.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2157 -1.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5463 -2.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0006 -2.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6705 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6703 -0.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8347 -1.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6705 -0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0002 -0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8358 -1.4468 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8353 1.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6707 -0.9645 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8354 0.4823 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8360 -2.4111 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3041 2.2512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6704 0.9644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7978 1.5043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2016 0.1597 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 26 1 0 0 0 0 4 5 2 0 0 0 0 4 7 1 0 0 0 0 5 8 1 0 0 0 0 6 10 1 0 0 0 0 6 11 1 0 0 0 0 7 14 2 0 0 0 0 8 16 2 0 0 0 0 9 12 1 0 0 0 0 9 15 1 0 0 0 0 10 20 1 0 0 0 0 11 22 1 0 0 0 0 12 22 1 0 0 0 0 13 20 1 0 0 0 0 13 21 1 0 0 0 0 14 15 1 0 0 0 0 14 16 1 0 0 0 0 15 17 2 0 0 0 0 16 23 1 0 0 0 0 17 18 1 0 0 0 0 17 23 1 0 0 0 0 18 20 1 1 0 0 0 18 22 1 0 0 0 0 19 24 2 0 0 0 0 19 26 1 0 0 0 0 20 3 1 6 0 0 0 21 19 1 6 0 0 0 21 23 1 0 0 0 0 21 25 1 0 0 0 0 25 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001618
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	15376
ChEBI
CAS Number

Drug Properties

Molecular Weight	354.19
ALogP	-0.4004
MLogP	3.22
XLogP	3.261
HDA	5
HBD	1
Rotatable Bonds	6
TPSA	54.7
RO5 Violation	0