NPASS drugs

Drug Information

Drug ID:	NPD4585
Drug Name:
Molecular Formula:	C21H25NO5
Canonical SMILES:	CNC1CCc2c(c3c1cc(=O)c(cc3)OC)c(OC)c(c(c2)OC)OC
Standard InCHI:	"InChI=1S/C21H25NO5/c1-22-15-8-6-12-10-18(25-3)20(26-4)21(27-5)19(12)13-7-9-17(24-2)16(23)11-14(13)15/h7,9-11,15,22H,6,8H2,1-5H3"
Standard InCHIKey:	NNJPGOLRFBJNIW-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4585

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	143508
0.1-0.2	66173
0.2-0.3	1949
0.3-0.4	74
0.4-0.5	11
0.5-0.6	16
0.6-0.7	3
0.7-0.8	4
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	2

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC556008
High Similarity	1.0	NPC612015
Intermediate Similarity	0.7119	NPC53146
Intermediate Similarity	0.7119	NPC563476
Intermediate Similarity	0.7	NPC188120
Intermediate Similarity	0.7	NPC551278
Remote Similarity	0.6557	NPC286790
Remote Similarity	0.6441	NPC571857
Remote Similarity	0.6441	NPC600354
Remote Similarity	0.5968	NPC190931
Remote Similarity	0.5873	NPC218575
Remote Similarity	0.5873	NPC301939
Remote Similarity	0.5846	NPC515843
Remote Similarity	0.5606	NPC44642
Remote Similarity	0.5606	NPC511909
Remote Similarity	0.5606	NPC600699
Remote Similarity	0.5606	NPC609718
Remote Similarity	0.5606	NPC611997
Remote Similarity	0.5522	NPC108957
Remote Similarity	0.5522	NPC14005
Remote Similarity	0.5522	NPC226941
Remote Similarity	0.5455	NPC573250
Remote Similarity	0.5362	NPC576135
Remote Similarity	0.5211	NPC517898
Remote Similarity	0.5211	NPC604863

Drug Structure

NPD4585 OpenBabel08211705262D 28 30 0 0 1 0 0 0 0 0999 V2000 -2.1623 -4.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3497 0.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0151 -2.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4942 -0.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3349 -3.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4914 -0.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1565 -2.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9309 -1.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2256 -2.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6623 -3.1472 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -3.0225 -2.1863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1716 -1.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1623 -4.0132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.8488 -2.7496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1271 -0.9027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6623 -4.8792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 22 1 0 0 0 0 2 24 1 0 0 0 0 3 25 1 0 0 0 0 4 26 1 0 0 0 0 5 27 1 0 0 0 0 6 8 1 0 0 0 0 6 12 1 0 0 0 0 7 9 1 0 0 0 0 7 13 2 0 0 0 0 8 15 1 0 0 0 0 9 17 2 0 0 0 0 10 12 2 0 0 0 0 10 18 1 0 0 0 0 11 14 2 0 0 0 0 11 16 1 0 0 0 0 12 19 1 0 0 0 0 13 14 1 0 0 0 0 13 19 1 0 0 0 0 14 15 1 0 0 0 0 15 22 1 0 0 0 0 16 17 1 0 0 0 0 16 23 2 0 0 0 0 17 24 1 0 0 0 0 18 20 2 0 0 0 0 18 25 1 0 0 0 0 19 21 2 0 0 0 0 20 21 1 0 0 0 0 20 26 1 0 0 0 0 21 27 1 0 0 0 0 22 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001634
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	2832
ChEBI
CAS Number

Drug Properties

Molecular Weight	371.17
ALogP	-0.6064
MLogP	3.11
XLogP	1.397
HDA	3
HBD	1
Rotatable Bonds	10
TPSA	66.02
RO5 Violation	0