Drug Information| Drug ID:   | NPD4564 |
| Drug Name:   | |
| Molecular Formula:   | C21H25N5O6 |
| Canonical SMILES:   | OC(=O)CCC(C(=O)O)NC(=O)c1ccc(cc1)CCC1CNc2c(C1)c(O)nc(=N)[nH]2 |
| Standard InCHI:   | "InChI=1S/C21H25N5O6/c22-21-25-17-14(19(30)26-21)9-12(10-23-17)2-1-11-3-5-13(6-4-11)18(29)24-15(20(31)32)7-8-16(27)28/h3-6,12,15H,1-2,7-10H2,(H,24,29)(H,27,28)(H,31,32)(H4,22,23,25,26,30)" |
| Standard InCHIKey:   | ZUQBAQVRAURMCL-UHFFFAOYSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4564Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6237 | NPC131450 |
| Remote Similarity | 0.6237 | NPC150469 |
| Remote Similarity | 0.6237 | NPC182057 |
| Remote Similarity | 0.6237 | NPC86831 |
| Remote Similarity | 0.6237 | NPC147298 |
| Remote Similarity | 0.5208 | NPC99201 |
| Remote Similarity | 0.5208 | NPC269681 |
| Remote Similarity | 0.5208 | NPC14849 |
| Remote Similarity | 0.5155 | NPC328611 |
| Molecular Weight   | 443.18 |
| ALogP   | -2.0049 |
| MLogP   | 2.56 |
| XLogP   | 2.57 |
| HDA   | 11 |
| HBD   | 7 |
| Rotatable Bonds   | 13 |
| TPSA   | 184.2 |
| RO5 Violation   | 2 |