NPASS drugs

Drug Information

Drug ID:	NPD4520
Drug Name:
Molecular Formula:	C21H25BrN2O3
Canonical SMILES:	COC(=O)[C@@]1(O)C[C@]2(CC)CCCN3[C@@H]2c2n1c1cc(Br)ccc1c2CC3
Standard InCHI:	"InChI=1S/C21H25BrN2O3/c1-3-20-8-4-9-23-10-7-15-14-6-5-13(22)11-16(14)24(17(15)18(20)23)21(26,12-20)19(25)27-2/h5-6,11,18,26H,3-4,7-10,12H2,1-2H3/t18-,20+,21+/m1/s1"
Standard InCHIKey:	WYIJGAVIVKPUGJ-GIVPXCGWSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4520

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	63570
0.1-0.2	147072
0.2-0.3	996
0.3-0.4	48
0.4-0.5	33
0.5-0.6	12
0.6-0.7	2
0.7-0.8	7
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7763	NPC3191
Intermediate Similarity	0.7763	NPC289299
Intermediate Similarity	0.7763	NPC255552
Intermediate Similarity	0.7763	NPC564694
Intermediate Similarity	0.7763	NPC611897
Intermediate Similarity	0.7692	NPC30671
Intermediate Similarity	0.7692	NPC541672
Remote Similarity	0.6506	NPC558271
Remote Similarity	0.6463	NPC588120
Remote Similarity	0.5632	NPC229888
Remote Similarity	0.5632	NPC63807
Remote Similarity	0.5506	NPC201293
Remote Similarity	0.5506	NPC222400
Remote Similarity	0.5385	NPC483942
Remote Similarity	0.5385	NPC483943
Remote Similarity	0.5333	NPC593593
Remote Similarity	0.5059	NPC81229
Remote Similarity	0.5059	NPC255229
Remote Similarity	0.5059	NPC207129
Remote Similarity	0.5059	NPC175688
Remote Similarity	0.5057	NPC503829

Drug Structure

NPD4520 OpenBabel08211705262D 28 32 0 0 1 0 0 0 0 0999 V2000 -2.9412 -1.0031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2335 2.3714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3189 -0.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1647 -2.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3475 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5107 -1.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8362 -2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2201 -1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5494 -2.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0006 -2.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5111 0.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6738 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3477 -0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6737 -0.9671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8364 -1.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6738 -0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0002 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8375 -1.4497 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8370 1.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6740 -0.9664 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8371 0.4833 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1632 0.4699 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0 -0.8377 -2.4159 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3047 2.2557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6738 0.9664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8014 1.5073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2060 0.1600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 27 1 0 0 0 0 4 8 1 0 0 0 0 4 9 1 0 0 0 0 5 6 2 0 0 0 0 5 13 1 0 0 0 0 6 14 1 0 0 0 0 7 10 1 0 0 0 0 7 15 1 0 0 0 0 8 20 1 0 0 0 0 9 23 1 0 0 0 0 10 23 1 0 0 0 0 11 13 2 0 0 0 0 11 16 1 0 0 0 0 12 20 1 0 0 0 0 12 21 1 0 0 0 0 13 22 1 0 0 0 0 14 15 1 0 0 0 0 14 16 2 0 0 0 0 15 17 2 0 0 0 0 16 24 1 0 0 0 0 17 18 1 0 0 0 0 17 24 1 0 0 0 0 18 20 1 1 0 0 0 18 23 1 0 0 0 0 19 25 2 0 0 0 0 19 27 1 0 0 0 0 20 3 1 6 0 0 0 21 19 1 6 0 0 0 21 24 1 0 0 0 0 21 26 1 0 0 0 0 26 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001524
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	5282434
ChEBI
CAS Number

Drug Properties

Molecular Weight	432.1
ALogP	0.4884
MLogP	3.11
XLogP	3.484
HDA	5
HBD	1
Rotatable Bonds	7
TPSA	54.7
RO5 Violation	0