Drug Information| Drug ID:   | NPD4504 |
| Drug Name:   | |
| Molecular Formula:   | C21H24N2O5 |
| Canonical SMILES:   | OC(=O)CCN=C([C@@H](N[C@H](C(=O)O)Cc1ccccc1)Cc1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C21H24N2O5/c24-19(25)11-12-22-20(26)17(13-15-7-3-1-4-8-15)23-18(21(27)28)14-16-9-5-2-6-10-16/h1-10,17-18,23H,11-14H2,(H,22,26)(H,24,25)(H,27,28)/t17-,18-/m0/s1" |
| Standard InCHIKey:   | WOVRTBFSWOVRST-ROUUACIJSA-N |
| Max Developmental Stage:   | Clinical (unspecified phase) |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4504Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5102 | NPC67043 |
| Molecular Weight   | 384.17 |
| ALogP   | -1.3488 |
| MLogP   | 3 |
| XLogP   | 5.918 |
| HDA   | 7 |
| HBD   | 4 |
| Rotatable Bonds   | 14 |
| TPSA   | 119.22 |
| RO5 Violation   | 2 |