NPASS drugs

Drug Information

Drug ID:	NPD4499
Drug Name:
Molecular Formula:	C21H24N2O2
Canonical SMILES:	CCC1=C[C@@H]2CN3[C@H]1[C@@](C2)(C(=O)OC)c1[nH]c2c(c1CC3)cccc2
Standard InCHI:	"InChI=1S/C21H24N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,10,13,19,22H,3,8-9,11-12H2,1-2H3/t13-,19+,21-/m0/s1"
Standard InCHIKey:	CMKFQVZJOWHHDV-NQZBTDCJSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4499

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	88099
0.1-0.2	119140
0.2-0.3	3479
0.3-0.4	743
0.4-0.5	242
0.5-0.6	16
0.6-0.7	12
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	1
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC314333
High Similarity	1.0	NPC573316
High Similarity	1.0	NPC606568
High Similarity	0.9296	NPC148337
Remote Similarity	0.6623	NPC329858
Remote Similarity	0.6623	NPC170271
Remote Similarity	0.6623	NPC571862
Remote Similarity	0.6456	NPC482061
Remote Similarity	0.6375	NPC187357
Remote Similarity	0.6375	NPC485936
Remote Similarity	0.6375	NPC485937
Remote Similarity	0.6375	NPC532483
Remote Similarity	0.6375	NPC558854
Remote Similarity	0.6375	NPC572358
Remote Similarity	0.622	NPC482060
Remote Similarity	0.6024	NPC505991
Remote Similarity	0.5854	NPC590765
Remote Similarity	0.5783	NPC485938
Remote Similarity	0.5783	NPC482062
Remote Similarity	0.5714	NPC482059
Remote Similarity	0.5455	NPC482063
Remote Similarity	0.5238	NPC556495
Remote Similarity	0.5116	NPC473041
Remote Similarity	0.5116	NPC520216
Remote Similarity	0.5116	NPC570346
Remote Similarity	0.5114	NPC187106
Remote Similarity	0.5114	NPC549358
Remote Similarity	0.5114	NPC557440
Remote Similarity	0.5057	NPC96321
Remote Similarity	0.5057	NPC111993
Remote Similarity	0.5057	NPC134263
Remote Similarity	0.5057	NPC609507

Drug Structure

NPD4499 OpenBabel08211705262D 26 30 0 0 1 0 0 0 0 0999 V2000 1.3658 -1.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3270 -6.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5265 -1.8367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2821 -1.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2821 -1.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5013 -0.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5013 -2.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6231 0.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7940 0.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5522 -1.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2901 -1.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6367 -0.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7658 -1.0541 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1784 -1.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7204 -1.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8629 -0.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7204 -1.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3330 -1.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1610 -0.8871 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2964 -4.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4322 -1.5661 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8629 -2.2551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 3.1979 -4.6358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8610 -5.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5843 -3.1126 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 25 1 0 0 0 0 3 14 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 15 2 0 0 0 0 7 17 2 0 0 0 0 8 9 1 0 0 0 0 8 16 1 0 0 0 0 9 23 1 0 0 0 0 10 14 2 0 0 0 0 11 13 1 0 0 0 0 11 21 1 0 0 0 0 12 13 1 0 0 0 0 12 23 1 0 0 0 0 13 10 1 6 0 0 0 14 19 1 0 0 0 0 15 16 1 0 0 0 0 15 17 1 0 0 0 0 16 18 2 0 0 0 0 17 22 1 0 0 0 0 18 21 1 0 0 0 0 18 22 1 0 0 0 0 19 21 1 6 0 0 0 19 23 1 0 0 0 0 20 24 2 0 0 0 0 20 25 1 0 0 0 0 21 20 1 6 0 0 0 22 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL000662
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	24796742
ChEBI
CAS Number

Drug Properties

Molecular Weight	336.18
ALogP	0.0568
MLogP	3.33
XLogP	3.136
HDA	4
HBD	1
Rotatable Bonds	5
TPSA	45.33
RO5 Violation	0