Drug Information| Drug ID:   | NPD4495 |
| Drug Name:   | Gs-9667 |
| Molecular Formula:   | C21H24FN5O4S |
| Canonical SMILES:   | O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2N[C@@H]1CCC[C@H]1O)CSc1ccccc1F |
| Standard InCHI:   | "InChI=1S/C21H24FN5O4S/c22-11-4-1-2-7-15(11)32-8-14-17(29)18(30)21(31-14)27-10-25-16-19(23-9-24-20(16)27)26-12-5-3-6-13(12)28/h1-2,4,7,9-10,12-14,17-18,21,28-30H,3,5-6,8H2,(H,23,24,26)/t12-,13-,14-,17-,18-,21-/m1/s1" |
| Standard InCHIKey:   | IZRXENCTXNMAMI-DIJFLQFKSA-N |
| Max Developmental Stage:   | Phase 1 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4495Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | DNCL001764 |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 11561692 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 461.15 |
| ALogP   | -1.8441 |
| MLogP   | 2.56 |
| XLogP   | 2.366 |
| HDA   | 9 |
| HBD   | 4 |
| Rotatable Bonds   | 10 |
| TPSA   | 150.85 |
| RO5 Violation   | 0 |