NPASS drugs

Drug Information

Drug ID:	NPD4482
Drug Name:	Diacetylmorphine
Molecular Formula:	C21H23NO5
Canonical SMILES:	CC(=O)O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1OC(=O)C
Standard InCHI:	"InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1"
Standard InCHIKey:	GVGLGOZIDCSQPN-PVHGPHFFSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4482

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	79942
0.1-0.2	129962
0.2-0.3	1748
0.3-0.4	38
0.4-0.5	24
0.5-0.6	20
0.6-0.7	2
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC311781
Intermediate Similarity	0.7826	NPC580459
Intermediate Similarity	0.7761	NPC318674
Intermediate Similarity	0.7761	NPC174783
Remote Similarity	0.6892	NPC43726
Remote Similarity	0.6892	NPC147161
Remote Similarity	0.5867	NPC214629
Remote Similarity	0.5843	NPC320999
Remote Similarity	0.5769	NPC140577
Remote Similarity	0.5769	NPC146628
Remote Similarity	0.575	NPC258640
Remote Similarity	0.5714	NPC43069
Remote Similarity	0.5714	NPC235802
Remote Similarity	0.5714	NPC262786
Remote Similarity	0.5714	NPC163601
Remote Similarity	0.5714	NPC2073
Remote Similarity	0.5714	NPC319632
Remote Similarity	0.5714	NPC612004
Remote Similarity	0.55	NPC238919
Remote Similarity	0.55	NPC70075
Remote Similarity	0.5325	NPC115906
Remote Similarity	0.5325	NPC608430
Remote Similarity	0.5176	NPC44953
Remote Similarity	0.5063	NPC305440
Remote Similarity	0.5063	NPC67346
Remote Similarity	0.5063	NPC599847

Drug Structure

NPD4482 OpenBabel08211705262D 27 31 0 0 1 0 0 0 0 0999 V2000 1.2322 3.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5133 -2.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1758 -1.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2217 1.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 -1.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4738 2.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4738 -2.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7176 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9697 0.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3733 2.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7341 -1.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 0.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2218 -0.8636 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9697 -0.4318 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7259 1.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 -1.7273 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4738 0.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 0.8632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7259 -0.8637 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4738 -0.4318 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7176 -0.8636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.1343 3.6464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6668 -0.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 2.1587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0220 -2.1591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 12 1 0 0 0 0 3 22 1 0 0 0 0 4 6 2 0 0 0 0 4 13 1 0 0 0 0 5 7 2 0 0 0 0 5 14 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 22 1 0 0 0 0 10 13 1 0 0 0 0 11 23 2 0 0 0 0 11 25 1 0 0 0 0 12 24 2 0 0 0 0 12 26 1 0 0 0 0 13 18 2 0 0 0 0 14 15 1 0 0 0 0 14 21 1 1 0 0 0 15 10 1 6 0 0 0 15 22 1 0 0 0 0 16 19 2 0 0 0 0 16 25 1 0 0 0 0 17 20 1 0 0 0 0 17 26 1 1 0 0 0 18 19 1 0 0 0 0 18 21 1 0 0 0 0 19 27 1 0 0 0 0 20 21 1 1 0 0 0 20 27 1 0 0 0 0 21 8 1 6 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001673
DrugBank	DB01452
ChEMBL	CHEMBL459324
IUPHAR/BPS
PharmaGKB	PA452619
KEGG Drug	D07286
PubChem CID	5462328
ChEBI	27808
CAS Number	561-27-3

Drug Properties

Molecular Weight	369.16
ALogP	0.1597
MLogP	3.11
XLogP	1.043
HDA	6
HBD	0
Rotatable Bonds	7
TPSA	65.07
RO5 Violation	0