Drug Information| Drug ID:   | NPD4481 |
| Drug Name:   | Diacetylmorphine Hydrochloride |
| Molecular Formula:   | C21H23NO5.ClH |
| Canonical SMILES:   | CC(=O)O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1OC(=O)C.Cl |
| Standard InCHI:   | "InChI=1S/C21H23NO5.ClH/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20;/h4-7,14-15,17,20H,8-10H2,1-3H3;1H/t14-,15+,17-,20-,21-;/m0./s1" |
| Standard InCHIKey:   | FZJYQGFGNHGSFX-PVQKIFDLSA-N |
| Max Developmental Stage:   | Phase 3 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD4481Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.9841 | NPC311781 |
| Intermediate Similarity | 0.7714 | NPC580459 |
| Intermediate Similarity | 0.7647 | NPC318674 |
| Intermediate Similarity | 0.7647 | NPC174783 |
| Remote Similarity | 0.68 | NPC43726 |
| Remote Similarity | 0.68 | NPC147161 |
| Remote Similarity | 0.5789 | NPC214629 |
| Remote Similarity | 0.5778 | NPC320999 |
| Remote Similarity | 0.5696 | NPC140577 |
| Remote Similarity | 0.5696 | NPC146628 |
| Remote Similarity | 0.5679 | NPC258640 |
| Remote Similarity | 0.5641 | NPC43069 |
| Remote Similarity | 0.5641 | NPC235802 |
| Remote Similarity | 0.5641 | NPC262786 |
| Remote Similarity | 0.5641 | NPC163601 |
| Remote Similarity | 0.5641 | NPC2073 |
| Remote Similarity | 0.5641 | NPC319632 |
| Remote Similarity | 0.5641 | NPC612004 |
| Remote Similarity | 0.5432 | NPC238919 |
| Remote Similarity | 0.5432 | NPC70075 |
| Remote Similarity | 0.5256 | NPC115906 |
| Remote Similarity | 0.5256 | NPC608430 |
| Remote Similarity | 0.5116 | NPC44953 |
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 369.16 |
| ALogP   | 0.0411 |
| MLogP   | 3.11 |
| XLogP   | 2.276 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 7 |
| TPSA   | 65.07 |
| RO5 Violation   | 0 |