NPASS drugs

Drug Information

Drug ID:	NPD4481
Drug Name:	Diacetylmorphine Hydrochloride
Molecular Formula:	C21H23NO5.ClH
Canonical SMILES:	CC(=O)O[C@H]1C=C[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1OC(=O)C.Cl
Standard InCHI:	"InChI=1S/C21H23NO5.ClH/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20;/h4-7,14-15,17,20H,8-10H2,1-3H3;1H/t14-,15+,17-,20-,21-;/m0./s1"
Standard InCHIKey:	FZJYQGFGNHGSFX-PVQKIFDLSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4481

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	80256
0.1-0.2	129766
0.2-0.3	1630
0.3-0.4	38
0.4-0.5	24
0.5-0.6	17
0.6-0.7	2
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.9841	NPC311781
Intermediate Similarity	0.7714	NPC580459
Intermediate Similarity	0.7647	NPC318674
Intermediate Similarity	0.7647	NPC174783
Remote Similarity	0.68	NPC43726
Remote Similarity	0.68	NPC147161
Remote Similarity	0.5789	NPC214629
Remote Similarity	0.5778	NPC320999
Remote Similarity	0.5696	NPC140577
Remote Similarity	0.5696	NPC146628
Remote Similarity	0.5679	NPC258640
Remote Similarity	0.5641	NPC43069
Remote Similarity	0.5641	NPC235802
Remote Similarity	0.5641	NPC262786
Remote Similarity	0.5641	NPC163601
Remote Similarity	0.5641	NPC2073
Remote Similarity	0.5641	NPC319632
Remote Similarity	0.5641	NPC612004
Remote Similarity	0.5432	NPC238919
Remote Similarity	0.5432	NPC70075
Remote Similarity	0.5256	NPC115906
Remote Similarity	0.5256	NPC608430
Remote Similarity	0.5116	NPC44953

Drug Structure

NPD4481 OpenBabel08211705262D 28 31 0 0 1 0 0 0 0 0999 V2000 5.8594 -1.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1405 -6.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4514 -5.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 -2.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 -5.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1534 -1.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1533 -6.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 -4.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9096 -4.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6575 -3.6663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0005 -1.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3613 -5.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 -3.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4054 -4.9614 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6575 -4.5296 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9013 -2.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9013 -5.8251 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1534 -3.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9013 -3.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9013 -4.9614 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1534 -4.5296 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9096 -4.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.4929 -0.4514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2940 -4.9071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6492 -1.9391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6492 -6.2569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6272 -4.0978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0896 -0.3872 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 11 1 0 0 0 0 2 12 1 0 0 0 0 3 22 1 0 0 0 0 4 6 2 0 0 0 0 4 13 1 0 0 0 0 5 7 2 0 0 0 0 5 14 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 8 9 1 0 0 0 0 9 22 1 0 0 0 0 10 13 1 0 0 0 0 11 23 2 0 0 0 0 11 25 1 0 0 0 0 12 24 2 0 0 0 0 12 26 1 0 0 0 0 13 18 2 0 0 0 0 14 15 1 0 0 0 0 14 21 1 1 0 0 0 15 10 1 6 0 0 0 15 22 1 0 0 0 0 16 19 2 0 0 0 0 16 25 1 0 0 0 0 17 20 1 0 0 0 0 17 26 1 1 0 0 0 18 19 1 0 0 0 0 18 21 1 0 0 0 0 19 27 1 0 0 0 0 20 21 1 1 0 0 0 20 27 1 0 0 0 0 21 8 1 6 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	369.16
ALogP	0.0411
MLogP	3.11
XLogP	2.276
HDA	4
HBD	0
Rotatable Bonds	7
TPSA	65.07
RO5 Violation	0