Drug Information| Drug ID:   | NPD4419 |
| Drug Name:   | |
| Molecular Formula:   | C21H21NO5 |
| Canonical SMILES:   | OCC1N(C)CCC1c1c(O)cc(c2c1oc(cc2=O)c1ccccc1)O |
| Standard InCHI:   | "InChI=1S/C21H21NO5/c1-22-8-7-13(14(22)11-23)19-15(24)9-16(25)20-17(26)10-18(27-21(19)20)12-5-3-2-4-6-12/h2-6,9-10,13-14,23-25H,7-8,11H2,1H3" |
| Standard InCHIKey:   | HRTOUPQLDWWXIX-UHFFFAOYSA-N |
| Max Developmental Stage:   | Phase 2 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD4419Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.589 | NPC536537 |
| Remote Similarity | 0.589 | NPC605239 |
| Remote Similarity | 0.5658 | NPC327005 |
| Remote Similarity | 0.5658 | NPC586708 |
| Remote Similarity | 0.5658 | NPC602981 |
| Remote Similarity | 0.55 | NPC264938 |
| Remote Similarity | 0.55 | NPC609581 |
| Remote Similarity | 0.5068 | NPC596668 |
| Remote Similarity | 0.5068 | NPC606140 |
| Molecular Weight   | 367.14 |
| ALogP   | -2.3903 |
| MLogP   | 3.11 |
| XLogP   | 2.413 |
| HDA   | 3 |
| HBD   | 3 |
| Rotatable Bonds   | 7 |
| TPSA   | 90.23 |
| RO5 Violation   | 0 |