Drug Information| Drug ID:   | NPD4217 |
| Drug Name:   | ipratropium |
| Molecular Formula:   | C20H30NO3 |
| Canonical SMILES:   | OCC(c1ccccc1)C(=O)OC1CC2CCC(C1)[N+]2(C)C(C)C |
| Standard InCHI:   | "InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1" |
| Standard InCHIKey:   | OEXHQOGQTVQTAT-UHFFFAOYSA-N |
| Max Developmental Stage:   | Approved |
| Max Developmental Stage Source:   | TTD; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD4217Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6731 | NPC540328 |
| Remote Similarity | 0.537 | NPC173810 |
| Remote Similarity | 0.5179 | NPC151003 |
| Remote Similarity | 0.5179 | NPC213126 |
| Remote Similarity | 0.5179 | NPC327589 |
| Remote Similarity | 0.5179 | NPC84281 |
| Remote Similarity | 0.5179 | NPC169485 |
| Remote Similarity | 0.5179 | NPC208067 |
| Remote Similarity | 0.5179 | NPC46780 |
| Remote Similarity | 0.5179 | NPC317474 |
| Remote Similarity | 0.5179 | NPC209773 |
| Remote Similarity | 0.5179 | NPC275579 |
| Remote Similarity | 0.5179 | NPC291027 |
| Remote Similarity | 0.5179 | NPC327013 |
| Remote Similarity | 0.5179 | NPC203064 |
| Remote Similarity | 0.5179 | NPC506376 |
| Remote Similarity | 0.5179 | NPC514276 |
| Remote Similarity | 0.5179 | NPC522081 |
| Remote Similarity | 0.5179 | NPC535803 |
| Remote Similarity | 0.5179 | NPC602420 |
| Remote Similarity | 0.5179 | NPC609072 |
| Remote Similarity | 0.5179 | NPC609554 |
| Remote Similarity | 0.5179 | NPC612042 |
| Molecular Weight   | 332.22 |
| ALogP   | -3.2771 |
| MLogP   | 3.22 |
| XLogP   | 4.23 |
| HDA   | 3 |
| HBD   | 1 |
| Rotatable Bonds   | 10 |
| TPSA   | 46.53 |
| RO5 Violation   | 0 |