NPASS drugs

Drug Information

Drug ID:	NPD4216
Drug Name:	Ipratropium bromide
Molecular Formula:	C20H30NO3.BrH
Canonical SMILES:	OCC(c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)[N@+]2(C)C(C)C.[Br-]
Standard InCHI:	"InChI=1S/C20H30NO3.BrH/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15;/h4-8,14,16-19,22H,9-13H2,1-3H3;1H/q+1;/p-1/t16-,17+,18+,19?,21+;"
Standard InCHIKey:	LHLMOSXCXGLMMN-VVQPYUEFSA-M
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4216

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	47045
0.1-0.2	155393
0.2-0.3	9220
0.3-0.4	22
0.4-0.5	36
0.5-0.6	23
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6604	NPC540328
Remote Similarity	0.5273	NPC173810
Remote Similarity	0.5088	NPC151003
Remote Similarity	0.5088	NPC213126
Remote Similarity	0.5088	NPC327589
Remote Similarity	0.5088	NPC84281
Remote Similarity	0.5088	NPC169485
Remote Similarity	0.5088	NPC208067
Remote Similarity	0.5088	NPC46780
Remote Similarity	0.5088	NPC317474
Remote Similarity	0.5088	NPC209773
Remote Similarity	0.5088	NPC275579
Remote Similarity	0.5088	NPC291027
Remote Similarity	0.5088	NPC327013
Remote Similarity	0.5088	NPC203064
Remote Similarity	0.5088	NPC506376
Remote Similarity	0.5088	NPC514276
Remote Similarity	0.5088	NPC522081
Remote Similarity	0.5088	NPC535803
Remote Similarity	0.5088	NPC602420
Remote Similarity	0.5088	NPC609072
Remote Similarity	0.5088	NPC609554
Remote Similarity	0.5088	NPC612042
Remote Similarity	0.5085	NPC287708

Drug Structure

NPD4216 OpenBabel08211704332D 26 27 0 0 1 0 0 0 0 0999 V2000 2.9684 -3.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3861 -3.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5617 -2.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6298 -3.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6298 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7997 -3.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7997 -1.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9696 -3.3549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6161 -0.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0283 -1.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9050 -0.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1423 -1.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3094 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9739 -2.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9696 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5671 -0.9826 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6161 -2.2916 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2709 -1.0408 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1395 -1.9171 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.1395 -0.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5671 -1.9826 0.0000 N 0 3 1 0 0 0 0 0 0 0 0 0 1.3094 -3.3549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9696 -0.4793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3094 -0.4793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3147 -2.6223 0.0000 Br 0 5 0 0 0 0 0 0 0 0 0 0 0.4793 -3.8341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 14 1 0 0 0 0 2 14 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 8 2 0 0 0 0 7 15 2 0 0 0 0 8 15 1 0 0 0 0 9 10 1 0 0 0 0 9 16 1 0 0 0 0 10 17 1 0 0 0 0 11 16 1 0 0 0 0 11 18 1 0 0 0 0 12 17 1 0 0 0 0 12 18 1 0 0 0 0 13 19 1 0 0 0 0 13 22 1 0 0 0 0 14 21 1 0 0 0 0 15 19 1 0 0 0 0 16 21 1 1 0 0 0 17 21 1 1 0 0 0 18 24 1 6 0 0 0 19 20 1 0 0 0 0 20 23 2 0 0 0 0 20 24 1 0 0 0 0 21 3 1 6 0 0 0 22 26 1 0 0 0 0 M CHG 2 21 1 25 -1 M END $$$$

External Identifiers

TTD	DNC000806
DrugBank	DB00332
ChEMBL	CHEMBL1908368
IUPHAR/BPS
PharmaGKB	PA450082
KEGG Drug
PubChem CID	0
ChEBI	46659
CAS Number	22254-24-6

Drug Properties

Molecular Weight	332.22
ALogP	-3.2771
MLogP	3.22
XLogP	4.23
HDA	3
HBD	1
Rotatable Bonds	10
TPSA	46.53
RO5 Violation	0