NPASS drugs

Drug Information

Drug ID:	NPD4181
Drug Name:	terguride
Molecular Formula:	C20H28N4O
Canonical SMILES:	CCN(C(=N[C@@H]1CN(C)[C@H]2[C@H](C1)c1cccc3c1c(C2)c[nH]3)O)CC
Standard InCHI:	"InChI=1S/C20H28N4O/c1-4-24(5-2)20(25)22-14-10-16-15-7-6-8-17-19(15)13(11-21-17)9-18(16)23(3)12-14/h6-8,11,14,16,18,21H,4-5,9-10,12H2,1-3H3,(H,22,25)/t14-,16+,18+/m0/s1"
Standard InCHIKey:	JOAHPSVPXZTVEP-YXJHDRRASA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4181

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	155584
0.1-0.2	54134
0.2-0.3	1851
0.3-0.4	130
0.4-0.5	31
0.5-0.6	7
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5775	NPC56765
Remote Similarity	0.5775	NPC175190
Remote Similarity	0.5775	NPC506981
Remote Similarity	0.5775	NPC602380
Remote Similarity	0.5694	NPC539861
Remote Similarity	0.5467	NPC586903
Remote Similarity	0.5467	NPC603365

Drug Structure

NPD4181 OpenBabel08211704332D 27 30 0 0 1 0 0 0 0 0999 V2000 -1.6084 1.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0816 -0.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0002 0.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6082 0.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2572 0.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3512 -3.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5676 -2.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1346 -2.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5671 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0004 -1.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1344 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7835 -0.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3510 -0.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7833 -1.3574 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5675 -1.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7839 -1.3571 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.1347 -1.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7837 -0.4522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3510 -1.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4324 -1.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9181 -1.3567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.6077 -1.8337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4326 -0.4057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2568 -1.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8299 -1.6009 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0814 -1.3582 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 3 23 1 0 0 0 0 4 24 1 0 0 0 0 5 24 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 7 15 1 0 0 0 0 8 17 2 0 0 0 0 9 13 1 0 0 0 0 10 14 1 0 0 0 0 11 13 2 0 0 0 0 11 21 1 0 0 0 0 12 14 1 0 0 0 0 12 23 1 0 0 0 0 13 19 1 0 0 0 0 14 22 1 6 0 0 0 15 16 1 0 0 0 0 15 19 2 0 0 0 0 16 10 1 1 0 0 0 16 18 1 0 0 0 0 17 19 1 0 0 0 0 17 21 1 0 0 0 0 18 9 1 6 0 0 0 18 23 1 0 0 0 0 20 22 2 3 0 0 0 20 24 1 0 0 0 0 20 25 1 0 0 0 0 21 26 1 0 0 0 0 25 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL001870
DrugBank
ChEMBL
IUPHAR/BPS	56
PharmaGKB
KEGG Drug
PubChem CID	443951
ChEBI
CAS Number

Drug Properties

Molecular Weight	340.23
ALogP	0.1366
MLogP	3.11
XLogP	3.578
HDA	5
HBD	2
Rotatable Bonds	8
TPSA	54.86
RO5 Violation	0