Drug Information| Drug ID:   | NPD4180 |
| Drug Name:   | Tamsulosin |
| Molecular Formula:   | C20H28N2O5S |
| Canonical SMILES:   | CCOc1ccccc1OCCN[C@@H](Cc1ccc(c(c1)S(=O)(=O)N)OC)C |
| Standard InCHI:   | "InChI=1S/C20H28N2O5S/c1-4-26-17-7-5-6-8-18(17)27-12-11-22-15(2)13-16-9-10-19(25-3)20(14-16)28(21,23)24/h5-10,14-15,22H,4,11-13H2,1-3H3,(H2,21,23,24)/t15-/m1/s1" |
| Standard InCHIKey:   | DRHKJLXJIQTDTD-OAHLLOKOSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD; ChEMBL; IUPHAR/BPS |
  Structural Similarity Between NPASS Natural Products and NPD4180Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
  Similar Natural Products High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC68898 |
| High Similarity | 1.0 | NPC206372 |
| High Similarity | 1.0 | NPC612086 |
| High Similarity | 0.98 | NPC203424 |
| High Similarity | 0.98 | NPC74295 |
| Molecular Weight   | 408.17 |
| ALogP   | -1.2777 |
| MLogP   | 2.78 |
| XLogP   | 2.678 |
| HDA   | 4 |
| HBD   | 2 |
| Rotatable Bonds   | 15 |
| TPSA   | 108.26 |
| RO5 Violation   | 1 |