NPASS drugs

Drug Information

Drug ID:	NPD4128
Drug Name:	Lisuride
Molecular Formula:	C20H26N4O
Canonical SMILES:	CCN(C(=N[C@@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)O)CC
Standard InCHI:	"InChI=1S/C20H26N4O/c1-4-24(5-2)20(25)22-14-10-16-15-7-6-8-17-19(15)13(11-21-17)9-18(16)23(3)12-14/h6-8,10-11,14,18,21H,4-5,9,12H2,1-3H3,(H,22,25)/t14-,18+/m0/s1"
Standard InCHIKey:	BKRGVLQUQGGVSM-KBXCAEBGSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4128

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	148423
0.1-0.2	61239
0.2-0.3	1932
0.3-0.4	43
0.4-0.5	71
0.5-0.6	32
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.589	NPC570281
Remote Similarity	0.575	NPC68354
Remote Similarity	0.575	NPC285055
Remote Similarity	0.561	NPC269208
Remote Similarity	0.5556	NPC589958
Remote Similarity	0.5556	NPC606264
Remote Similarity	0.5526	NPC508875
Remote Similarity	0.5526	NPC509923
Remote Similarity	0.5513	NPC313654
Remote Similarity	0.5467	NPC57047
Remote Similarity	0.5467	NPC598241
Remote Similarity	0.5405	NPC90408
Remote Similarity	0.5405	NPC230660
Remote Similarity	0.5395	NPC194411
Remote Similarity	0.5375	NPC558145
Remote Similarity	0.5375	NPC572522
Remote Similarity	0.5342	NPC567556
Remote Similarity	0.5342	NPC600946
Remote Similarity	0.5176	NPC526211
Remote Similarity	0.5176	NPC611966
Remote Similarity	0.5132	NPC275305
Remote Similarity	0.5132	NPC37423
Remote Similarity	0.5132	NPC113927
Remote Similarity	0.5132	NPC19757
Remote Similarity	0.5132	NPC491234
Remote Similarity	0.5132	NPC577263
Remote Similarity	0.5119	NPC325904
Remote Similarity	0.5119	NPC520778
Remote Similarity	0.5119	NPC593969
Remote Similarity	0.5119	NPC604662
Remote Similarity	0.5116	NPC504538
Remote Similarity	0.5111	NPC46468

Drug Structure

NPD4128 OpenBabel08211704332D 27 30 0 0 1 0 0 0 0 0999 V2000 -1.6084 1.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0816 -0.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0002 0.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6082 0.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2572 0.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3512 -3.1665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5676 -2.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1346 -2.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5671 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0004 -1.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1344 0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7835 -0.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3510 -0.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7833 -1.3574 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5675 -1.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7839 -1.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1347 -1.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7837 -0.4522 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3510 -1.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4324 -1.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9181 -1.3567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.6077 -1.8337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4326 -0.4057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.2568 -1.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8299 -1.6009 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0814 -1.3582 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 3 23 1 0 0 0 0 4 24 1 0 0 0 0 5 24 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 7 15 1 0 0 0 0 8 17 2 0 0 0 0 9 13 1 0 0 0 0 10 14 1 0 0 0 0 10 16 2 0 0 0 0 11 13 2 0 0 0 0 11 21 1 0 0 0 0 12 14 1 0 0 0 0 12 23 1 0 0 0 0 13 19 1 0 0 0 0 14 22 1 6 0 0 0 15 16 1 0 0 0 0 15 19 2 0 0 0 0 16 18 1 0 0 0 0 17 19 1 0 0 0 0 17 21 1 0 0 0 0 18 9 1 6 0 0 0 18 23 1 0 0 0 0 20 22 2 3 0 0 0 20 24 1 0 0 0 0 20 25 1 0 0 0 0 21 26 1 0 0 0 0 25 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000255; DIB004751
DrugBank	DB00589
ChEMBL	CHEMBL157138
IUPHAR/BPS	43
PharmaGKB	PA164749019
KEGG Drug	D08132
PubChem CID	28864
ChEBI	51164
CAS Number	18016-80-3

Drug Properties

Molecular Weight	338.21
ALogP	0.4593
MLogP	3.11
XLogP	3.105
HDA	5
HBD	2
Rotatable Bonds	8
TPSA	54.86
RO5 Violation	0