NPASS drugs

Drug Information

Drug ID:	NPD4122
Drug Name:	Hydroquinine
Molecular Formula:	C20H26N2O2
Canonical SMILES:	CCC1CN2CCC1CC2[C@@H](c1ccnc2c1cc(OC)cc2)O
Standard InCHI:	"InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3/t13?,14?,19?,20-/m1/s1"
Standard InCHIKey:	LJOQGZACKSYWCH-WGFDLZGGSA-N
Max Developmental Stage:	Pre-clinical
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4122

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	87569
0.1-0.2	120089
0.2-0.3	4032
0.3-0.4	14
0.4-0.5	5
0.5-0.6	14
0.6-0.7	0
0.7-0.8	6
0.8-0.85	6
0.85-0.9	0
0.9-0.95	0
0.95-1	5

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC165349
High Similarity	1.0	NPC47059
High Similarity	1.0	NPC324027
High Similarity	1.0	NPC524941
High Similarity	1.0	NPC610890
Intermediate Similarity	0.8462	NPC118832
Intermediate Similarity	0.8462	NPC323216
Intermediate Similarity	0.8462	NPC329708
Intermediate Similarity	0.8462	NPC600335
Intermediate Similarity	0.8462	NPC612041
Intermediate Similarity	0.8462	NPC612068
Intermediate Similarity	0.7121	NPC284856
Intermediate Similarity	0.7121	NPC317308
Intermediate Similarity	0.7015	NPC567483
Intermediate Similarity	0.7015	NPC610661
Intermediate Similarity	0.7	NPC169000
Intermediate Similarity	0.7	NPC125707
Remote Similarity	0.5972	NPC203754
Remote Similarity	0.5972	NPC150048
Remote Similarity	0.5972	NPC39142
Remote Similarity	0.5972	NPC593604
Remote Similarity	0.5972	NPC602282
Remote Similarity	0.5972	NPC603090
Remote Similarity	0.589	NPC242808
Remote Similarity	0.589	NPC322558
Remote Similarity	0.5733	NPC276917
Remote Similarity	0.5733	NPC227320
Remote Similarity	0.5658	NPC86901
Remote Similarity	0.5584	NPC251430
Remote Similarity	0.5584	NPC288611
Remote Similarity	0.5125	NPC181631

Drug Structure

NPD4122 OpenBabel08211704332D 25 28 0 0 1 0 0 0 0 0999 V2000 -5.3560 1.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7910 4.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7324 1.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7903 2.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7904 1.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5811 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3717 1.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7905 -0.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3718 2.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9529 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7908 2.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4852 2.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4851 1.4715 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -3.1622 0.9124 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.0003 2.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5812 0.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7907 1.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0001 0.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9530 2.2816 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -4.7436 2.7380 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1624 2.7383 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -5.1398 3.5604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0004 3.6514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0501 3.6285 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 24 1 0 0 0 0 3 13 1 0 0 0 0 4 5 2 0 0 0 0 4 15 1 0 0 0 0 5 18 1 0 0 0 0 6 8 2 0 0 0 0 6 16 1 0 0 0 0 7 9 1 0 0 0 0 7 14 1 0 0 0 0 8 21 1 0 0 0 0 9 22 1 0 0 0 0 10 14 1 0 0 0 0 10 19 1 0 0 0 0 11 15 2 0 0 0 0 11 17 1 0 0 0 0 12 13 1 0 0 0 0 12 22 1 0 0 0 0 13 14 1 0 0 0 0 15 24 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 18 21 2 0 0 0 0 19 20 1 0 0 0 0 19 22 1 0 0 0 0 20 16 1 1 0 0 0 20 23 1 0 0 0 0 23 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	326.2
ALogP	-1.4578
MLogP	3.22
XLogP	3.032
HDA	3
HBD	1
Rotatable Bonds	7
TPSA	45.59
RO5 Violation	0