NPASS drugs

Drug Information

Drug ID:	NPD4120
Drug Name:	Ajmaline
Molecular Formula:	C20H26N2O2
Canonical SMILES:	CC[C@H]1[C@@H]2C[C@@H]3N([C@@H]1O)[C@@H]1C2[C@@H](O)[C@]2([C@H]3N(C)c3c2cccc3)C1
Standard InCHI:	InChI=1S/C20H26N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-19,23-24H,3,8-9H2,1-2H3/t10-,11-,14-,15-,16?,17-,18+,19+,20+/m0/s1
Standard InCHIKey:	CJDRUOGAGYHKKD-HEFSZTOGSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4120

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	169
0.1-0.2	991
0.2-0.3	3255
0.3-0.4	15756
0.4-0.5	7496
0.5-0.6	2710
0.6-0.7	439
0.7-0.8	66
0.8-0.85	7
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.8805	NPC476441
Intermediate Similarity	0.8447	NPC476425
Intermediate Similarity	0.8411	NPC472100
Intermediate Similarity	0.8375	NPC469462
Intermediate Similarity	0.8364	NPC476428
Intermediate Similarity	0.8205	NPC478076
Intermediate Similarity	0.8072	NPC476326
Intermediate Similarity	0.8039	NPC472103
Intermediate Similarity	0.7914	NPC472106
Intermediate Similarity	0.7901	NPC472120

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4120 OpenBabel08211704332D 26 31 0 0 1 0 0 0 0 0999 V2000 -1.7448 -1.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8013 0.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7276 -0.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9767 2.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6084 2.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3591 2.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6226 1.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1728 -0.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4511 0.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8656 0.0151 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8569 0.5149 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3732 1.7771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0050 1.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6983 0.1267 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5344 0.4669 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8390 1.4042 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 1.0346 0.7517 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0417 1.9835 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4372 -0.2424 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7557 1.4042 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0191 0.7074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 -0.0417 2.9691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.4543 -1.2277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8118 3.4618 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3905 -1.7353 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 21 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 12 2 0 0 0 0 7 13 2 0 0 0 0 9 15 1 0 0 0 0 10 3 1 1 0 0 0 10 11 1 0 0 0 0 10 19 1 0 0 0 0 11 8 1 6 0 0 0 11 16 1 0 0 0 0 12 13 1 0 0 0 0 12 20 1 0 0 0 0 13 21 1 0 0 0 0 14 8 1 6 0 0 0 14 17 1 0 0 0 0 14 22 1 0 0 0 0 15 16 1 0 0 0 0 15 22 1 6 0 0 0 16 18 1 0 0 0 0 17 20 1 1 0 0 0 17 21 1 0 0 0 0 18 20 1 1 0 0 0 18 23 1 0 0 0 0 19 22 1 6 0 0 0 19 24 1 0 0 0 0 20 9 1 1 0 0 0 23 25 1 0 0 0 0 24 26 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB01426
ChEMBL	CHEMBL2357792
IUPHAR/BPS
PharmaGKB	PA164776839
KEGG Drug	D00199
PubChem CID
ChEBI	28462
CAS Number

Drug Properties

Molecular Weight	326.20
ALogP	-2.0681
MLogP	3.22
XLogP	2.61
HDA	4
HBD	2
Rotatable Bonds	5
TPSA	46.94
RO5 Violation	0