NPASS drugs

Drug Information

Drug ID:	NPD4118
Drug Name:
Molecular Formula:	C20H26N2O
Canonical SMILES:	CCC1CC2CN3C1C(C2)c1[nH]c2c(c1CC3)cc(cc2)OC
Standard InCHI:	"InChI=1S/C20H26N2O/c1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3"
Standard InCHIKey:	HSIBGVUMFOSJPD-UHFFFAOYSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD4118

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	131634
0.1-0.2	77746
0.2-0.3	1986
0.3-0.4	276
0.4-0.5	57
0.5-0.6	18
0.6-0.7	5
0.7-0.8	9
0.8-0.85	4
0.85-0.9	0
0.9-0.95	0
0.95-1	3

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC329793
High Similarity	1.0	NPC582648
High Similarity	1.0	NPC600762
Intermediate Similarity	0.8235	NPC53167
Intermediate Similarity	0.8235	NPC68842
Intermediate Similarity	0.8235	NPC501232
Intermediate Similarity	0.8235	NPC584192
Intermediate Similarity	0.7794	NPC329747
Intermediate Similarity	0.7794	NPC147737
Intermediate Similarity	0.7794	NPC502631
Intermediate Similarity	0.7324	NPC270001
Intermediate Similarity	0.7286	NPC478078
Intermediate Similarity	0.7123	NPC471304
Intermediate Similarity	0.7059	NPC21605
Intermediate Similarity	0.7059	NPC215538
Intermediate Similarity	0.7059	NPC601147
Remote Similarity	0.675	NPC478074
Remote Similarity	0.6154	NPC96321
Remote Similarity	0.6154	NPC111993
Remote Similarity	0.6154	NPC134263
Remote Similarity	0.6154	NPC609507
Remote Similarity	0.5867	NPC189812
Remote Similarity	0.5867	NPC329688
Remote Similarity	0.5867	NPC574888
Remote Similarity	0.5657	NPC485894
Remote Similarity	0.5657	NPC477066
Remote Similarity	0.5625	NPC475910
Remote Similarity	0.5357	NPC160873
Remote Similarity	0.5357	NPC474192
Remote Similarity	0.5357	NPC570037
Remote Similarity	0.5357	NPC591277
Remote Similarity	0.5333	NPC485921
Remote Similarity	0.5333	NPC478082
Remote Similarity	0.5333	NPC477067
Remote Similarity	0.5234	NPC478081
Remote Similarity	0.5152	NPC485962
Remote Similarity	0.5152	NPC477065
Remote Similarity	0.5094	NPC485893
Remote Similarity	0.5045	NPC478080

Drug Structure

NPD4118 OpenBabel08211704332D 24 28 0 0 1 0 0 0 0 0999 V2000 -0.8371 2.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4813 1.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1268 2.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7493 2.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8832 2.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8001 -0.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8806 -0.4739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1321 1.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1856 1.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8832 0.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8011 -0.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3288 0.5679 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.3784 1.5326 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 4.7493 1.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0662 0.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0172 1.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4794 1.7370 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 3.0172 2.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4784 1.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1786 0.9839 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 2.0662 2.5012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 3 0 0 0 0 0 0 0 0 0 5.6153 0.6921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7571 3.4522 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 23 1 0 0 0 0 3 13 1 0 0 0 0 4 5 2 0 0 0 0 4 14 1 0 0 0 0 5 18 1 0 0 0 0 6 7 1 0 0 0 0 6 15 1 0 0 0 0 7 22 1 0 0 0 0 8 12 1 0 0 0 0 8 13 1 0 0 0 0 9 12 1 0 0 0 0 9 17 1 0 0 0 0 10 14 2 0 0 0 0 10 16 1 0 0 0 0 11 12 1 0 0 0 0 11 22 1 0 0 0 0 13 20 1 0 0 0 0 14 23 1 0 0 0 0 15 16 1 0 0 0 0 15 19 2 0 0 0 0 16 18 2 0 0 0 0 17 19 1 0 0 0 0 17 20 1 0 0 0 0 18 21 1 0 0 0 0 19 21 1 0 0 0 0 20 22 1 0 0 0 0 21 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DPR000010
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	9821813
ChEBI
CAS Number

Drug Properties

Molecular Weight	310.2
ALogP	-1.2608
MLogP	3.33
XLogP	3.58
HDA	2
HBD	1
Rotatable Bonds	4
TPSA	28.26
RO5 Violation	0